Add preliminary support for nitter-proxy

Improve headers
Minor fix
2025-12-06 03:55:36 -05:00 · 2025-12-06 05:15:01 +01:00 · 2025-12-06 05:00:34 +01:00 · 2025-11-30 18:07:27 +01:00 · 2025-11-30 18:06:22 +01:00 · 2025-11-30 05:43:17 +01:00
64 changed files with 2424 additions and 1597 deletions
--- a/.github/workflows/run-tests.yml
+++ b/.github/workflows/run-tests.yml
@@ -23,7 +23,7 @@ jobs:
    runs-on: buildjet-2vcpu-ubuntu-2204
    strategy:
      matrix:
-        nim: ["1.6.x", "2.0.x", "2.2.x", "devel"]
+        nim: ["2.0.x", "2.2.x", "devel"]
    steps:
      - name: Checkout Code
        uses: actions/checkout@v4
--- a/nitter.example.conf
+++ b/nitter.example.conf
@@ -26,6 +26,8 @@ enableRSS = true  # set this to false to disable RSS feeds
 enableDebug = false  # enable request logs and debug endpoints (/.sessions)
 proxy = ""  # http/https url, SOCKS proxies are not supported
 proxyAuth = ""
+apiProxy = "" # nitter-proxy host, e.g. localhost:7000
+disableTid = false # enable this if cookie-based auth is failing

 # Change default preferences here, see src/prefs_impl.nim for a complete list
 [Preferences]
--- a/nitter.nimble
+++ b/nitter.nimble
@@ -10,7 +10,7 @@ bin           = @["nitter"]

 # Dependencies

-requires "nim >= 1.6.10"
+requires "nim >= 2.0.0"
 requires "jester#baca3f"
 requires "karax#5cf360c"
 requires "sass#7dfdd03"
--- a/public/css/fontello.css
+++ b/public/css/fontello.css
@@ -1,53 +1,138 @@
@font-face {
-  font-family: 'fontello';
-  src: url('/fonts/fontello.eot?21002321');
-  src: url('/fonts/fontello.eot?21002321#iefix') format('embedded-opentype'),
-       url('/fonts/fontello.woff2?21002321') format('woff2'),
-       url('/fonts/fontello.woff?21002321') format('woff'),
-       url('/fonts/fontello.ttf?21002321') format('truetype'),
-       url('/fonts/fontello.svg?21002321#fontello') format('svg');
+  font-family: "fontello";
+  src: url("/fonts/fontello.eot?77185648");
+  src:
+    url("/fonts/fontello.eot?77185648#iefix") format("embedded-opentype"),
+    url("/fonts/fontello.woff2?77185648") format("woff2"),
+    url("/fonts/fontello.woff?77185648") format("woff"),
+    url("/fonts/fontello.ttf?77185648") format("truetype"),
+    url("/fonts/fontello.svg?77185648#fontello") format("svg");
  font-weight: normal;
  font-style: normal;
 }

- [class^="icon-"]:before, [class*=" icon-"]:before {
+[class^="icon-"]:before,
+[class*=" icon-"]:before {
  font-family: "fontello";
  font-style: normal;
  font-weight: normal;
  speak: never;
- 
+
  display: inline-block;
  text-decoration: inherit;
  width: 1em;
+  margin-right: 0.2em;
  text-align: center;

  /* For safety - reset parent styles, that can break glyph codes*/
  font-variant: normal;
  text-transform: none;
- 
+
  /* fix buttons height, for twitter bootstrap */
  line-height: 1em;
- 
+
  /* Font smoothing. That was taken from TWBS */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
 }
- 
-.icon-heart:before { content: '\2665'; } /* '♥' */
-.icon-quote:before { content: '\275e'; } /* '❞' */
-.icon-comment:before { content: '\e802'; } /* '' */
-.icon-ok:before { content: '\e803'; } /* '' */
-.icon-play:before { content: '\e804'; } /* '' */
-.icon-link:before { content: '\e805'; } /* '' */
-.icon-calendar:before { content: '\e806'; } /* '' */
-.icon-location:before { content: '\e807'; } /* '' */
-.icon-picture:before { content: '\e809'; } /* '' */
-.icon-lock:before { content: '\e80a'; } /* '' */
-.icon-down:before { content: '\e80b'; } /* '' */
-.icon-retweet:before { content: '\e80d'; } /* '' */
-.icon-search:before { content: '\e80e'; } /* '' */
-.icon-pin:before { content: '\e80f'; } /* '' */
-.icon-cog:before { content: '\e812'; } /* '' */
-.icon-rss-feed:before { content: '\e813'; } /* '' */
-.icon-info:before { content: '\f128'; } /* '' */
-.icon-bird:before { content: '\f309'; } /* '' */
+
+.icon-views:before {
+  content: "\e800";
+}
+
+/* '' */
+.icon-heart:before {
+  content: "\e801";
+}
+
+/* '' */
+.icon-quote:before {
+  content: "\e802";
+}
+
+/* '' */
+.icon-comment:before {
+  content: "\e803";
+}
+
+/* '' */
+.icon-play:before {
+  content: "\e805";
+}
+
+/* '' */
+.icon-link:before {
+  content: "\e806";
+}
+
+/* '' */
+.icon-calendar:before {
+  content: "\e807";
+}
+
+/* '' */
+.icon-location:before {
+  content: "\e808";
+}
+
+/* '' */
+.icon-picture:before {
+  content: "\e809";
+}
+
+/* '' */
+.icon-lock:before {
+  content: "\e80a";
+}
+
+/* '' */
+.icon-down:before {
+  content: "\e80b";
+}
+
+/* '' */
+.icon-retweet:before {
+  content: "\e80c";
+}
+
+/* '' */
+.icon-search:before {
+  content: "\e80d";
+}
+
+/* '' */
+.icon-pin:before {
+  content: "\e80e";
+}
+
+/* '' */
+.icon-cog:before {
+  content: "\e80f";
+}
+
+/* '' */
+.icon-rss:before {
+  content: "\e810";
+}
+
+/* '' */
+.icon-ok:before {
+  content: "\e811";
+}
+
+/* '' */
+.icon-circle:before {
+  content: "\f111";
+}
+
+/* '' */
+.icon-info:before {
+  content: "\f128";
+}
+
+/* '' */
+.icon-bird:before {
+  content: "\f309";
+}
+
+/* '' */
--- a/public/fonts/LICENSE.txt
+++ b/public/fonts/LICENSE.txt
@@ -1,6 +1,15 @@
 Font license info


+## Modern Pictograms
+
+   Copyright (c) 2012 by John Caserta. All rights reserved.
+
+   Author:    John Caserta
+   License:   SIL (http://scripts.sil.org/OFL)
+   Homepage:  http://thedesignoffice.org/project/modern-pictograms/
+
+
 ## Entypo

   Copyright (C) 2012 by Daniel Bruce
@@ -37,12 +46,3 @@ Font license info
   Homepage:  http://aristeides.com/


-## Modern Pictograms
-
-   Copyright (c) 2012 by John Caserta. All rights reserved.
-
-   Author:    John Caserta
-   License:   SIL (http://scripts.sil.org/OFL)
-   Homepage:  http://thedesignoffice.org/project/modern-pictograms/
-
-
--- a/public/fonts/fontello.eot
+++ b/public/fonts/fontello.eot
--- a/public/fonts/fontello.svg
+++ b/public/fonts/fontello.svg
@@ -1,26 +1,26 @@
 <?xml version="1.0" standalone="no"?>
 <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
 <svg xmlns="http://www.w3.org/2000/svg">
-<metadata>Copyright (C) 2020 by original authors @ fontello.com</metadata>
+<metadata>Copyright (C) 2025 by original authors @ fontello.com</metadata>
 <defs>
 <font id="fontello" horiz-adv-x="1000" >
 <font-face font-family="fontello" font-weight="400" font-stretch="normal" units-per-em="1000" ascent="850" descent="-150" />
 <missing-glyph horiz-adv-x="1000" />
-<glyph glyph-name="heart" unicode="&#x2665;" d="M790 644q70-64 70-156t-70-158l-360-330-360 330q-70 66-70 158t70 156q62 58 151 58t153-58l56-52 58 52q62 58 150 58t152-58z" horiz-adv-x="860" />
+<glyph glyph-name="views" unicode="&#xe800;" d="M180 516l0-538-180 0 0 538 180 0z m250-138l0-400-180 0 0 400 180 0z m250 344l0-744-180 0 0 744 180 0z" horiz-adv-x="680" />

-<glyph glyph-name="quote" unicode="&#x275e;" d="M18 685l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z m558 0l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z" horiz-adv-x="928" />
+<glyph glyph-name="heart" unicode="&#xe801;" d="M790 644q70-64 70-156t-70-158l-360-330-360 330q-70 66-70 158t70 156q62 58 151 58t153-58l56-52 58 52q62 58 150 58t152-58z" horiz-adv-x="860" />

-<glyph glyph-name="comment" unicode="&#xe802;" d="M1000 350q0-97-67-179t-182-130-251-48q-39 0-81 4-110-97-257-135-27-8-63-12-10-1-17 5t-10 16v1q-2 2 0 6t1 6 2 5l4 5t4 5 4 5q4 5 17 19t20 22 17 22 18 28 15 33 15 42q-88 50-138 123t-51 157q0 73 40 139t106 114 160 76 194 28q136 0 251-48t182-130 67-179z" horiz-adv-x="1000" />
+<glyph glyph-name="quote" unicode="&#xe802;" d="M18 685l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z m558 0l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z" horiz-adv-x="928" />

-<glyph glyph-name="ok" unicode="&#xe803;" d="M0 260l162 162 166-164 508 510 164-164-510-510-162-162-162 164z" horiz-adv-x="1000" />
+<glyph glyph-name="comment" unicode="&#xe803;" d="M1000 350q0-97-67-179t-182-130-251-48q-39 0-81 4-110-97-257-135-27-8-63-12-10-1-17 5t-10 16v1q-2 2 0 6t1 6 2 5l4 5t4 5 4 5q4 5 17 19t20 22 17 22 18 28 15 33 15 42q-88 50-138 123t-51 157q0 73 40 139t106 114 160 76 194 28q136 0 251-48t182-130 67-179z" horiz-adv-x="1000" />

-<glyph glyph-name="play" unicode="&#xe804;" d="M772 333l-741-412q-13-7-22-2t-9 20v822q0 14 9 20t22-2l741-412q13-7 13-17t-13-17z" horiz-adv-x="785.7" />
+<glyph glyph-name="play" unicode="&#xe805;" d="M772 333l-741-412q-13-7-22-2t-9 20v822q0 14 9 20t22-2l741-412q13-7 13-17t-13-17z" horiz-adv-x="785.7" />

-<glyph glyph-name="link" unicode="&#xe805;" d="M294 116q14 14 34 14t36-14q32-34 0-70l-42-40q-56-56-132-56-78 0-134 56t-56 132q0 78 56 134l148 148q70 68 144 77t128-43q16-16 16-36t-16-36q-36-32-70 0-50 48-132-34l-148-146q-26-26-26-64t26-62q26-26 63-26t63 26z m450 574q56-56 56-132 0-78-56-134l-158-158q-74-72-150-72-62 0-112 50-14 14-14 34t14 36q14 14 35 14t35-14q50-48 122 24l158 156q28 28 28 64 0 38-28 62-24 26-56 31t-60-21l-50-50q-16-14-36-14t-34 14q-34 34 0 70l50 50q54 54 127 51t129-61z" horiz-adv-x="800" />
+<glyph glyph-name="link" unicode="&#xe806;" d="M294 116q14 14 34 14t36-14q32-34 0-70l-42-40q-56-56-132-56-78 0-134 56t-56 132q0 78 56 134l148 148q70 68 144 77t128-43q16-16 16-36t-16-36q-36-32-70 0-50 48-132-34l-148-146q-26-26-26-64t26-62q26-26 63-26t63 26z m450 574q56-56 56-132 0-78-56-134l-158-158q-74-72-150-72-62 0-112 50-14 14-14 34t14 36q14 14 35 14t35-14q50-48 122 24l158 156q28 28 28 64 0 38-28 62-24 26-56 31t-60-21l-50-50q-16-14-36-14t-34 14q-34 34 0 70l50 50q54 54 127 51t129-61z" horiz-adv-x="800" />

-<glyph glyph-name="calendar" unicode="&#xe806;" d="M800 700q42 0 71-29t29-71l0-600q0-40-29-70t-71-30l-700 0q-40 0-70 30t-30 70l0 600q0 42 30 71t70 29l46 0 0-100 160 0 0 100 290 0 0-100 160 0 0 100 44 0z m0-700l0 400-700 0 0-400 700 0z m-540 800l0-170-70 0 0 170 70 0z m450 0l0-170-70 0 0 170 70 0z" horiz-adv-x="900" />
+<glyph glyph-name="calendar" unicode="&#xe807;" d="M800 700q42 0 71-29t29-71l0-600q0-40-29-70t-71-30l-700 0q-40 0-70 30t-30 70l0 600q0 42 30 71t70 29l46 0 0-100 160 0 0 100 290 0 0-100 160 0 0 100 44 0z m0-700l0 400-700 0 0-400 700 0z m-540 800l0-170-70 0 0 170 70 0z m450 0l0-170-70 0 0 170 70 0z" horiz-adv-x="900" />

-<glyph glyph-name="location" unicode="&#xe807;" d="M250 750q104 0 177-73t73-177q0-106-62-243t-126-223l-62-84q-10 12-27 35t-60 89-76 130-60 147-27 149q0 104 73 177t177 73z m0-388q56 0 96 40t40 96-40 95-96 39-95-39-39-95 39-96 95-40z" horiz-adv-x="500" />
+<glyph glyph-name="location" unicode="&#xe808;" d="M250 750q104 0 177-73t73-177q0-106-62-243t-126-223l-62-84q-10 12-27 35t-60 89-76 130-60 147-27 149q0 104 73 177t177 73z m0-388q56 0 96 40t40 96-40 95-96 39-95-39-39-95 39-96 95-40z" horiz-adv-x="500" />

 <glyph glyph-name="picture" unicode="&#xe809;" d="M357 529q0-45-31-76t-76-32-76 32-31 76 31 76 76 31 76-31 31-76z m572-215v-250h-786v107l178 179 90-89 285 285z m53 393h-893q-7 0-12-5t-6-13v-678q0-7 6-13t12-5h893q7 0 13 5t5 13v678q0 8-5 13t-13 5z m89-18v-678q0-37-26-63t-63-27h-893q-36 0-63 27t-26 63v678q0 37 26 63t63 27h893q37 0 63-27t26-63z" horiz-adv-x="1071.4" />

@@ -28,19 +28,23 @@

 <glyph glyph-name="down" unicode="&#xe80b;" d="M939 399l-414-413q-10-11-25-11t-25 11l-414 413q-11 11-11 26t11 25l93 92q10 11 25 11t25-11l296-296 296 296q11 11 25 11t26-11l92-92q11-11 11-25t-11-26z" horiz-adv-x="1000" />

-<glyph glyph-name="retweet" unicode="&#xe80d;" d="M714 11q0-7-5-13t-13-5h-535q-5 0-8 1t-5 4-3 4-2 7 0 6v335h-107q-15 0-25 11t-11 25q0 13 8 23l179 214q11 12 27 12t28-12l178-214q9-10 9-23 0-15-11-25t-25-11h-107v-214h321q9 0 14-6l89-108q4-5 4-11z m357 232q0-13-8-23l-178-214q-12-13-28-13t-27 13l-179 214q-8 10-8 23 0 14 11 25t25 11h107v214h-322q-9 0-14 7l-89 107q-4 5-4 11 0 7 5 12t13 6h536q4 0 7-1t5-4 3-5 2-6 1-7v-334h107q14 0 25-11t10-25z" horiz-adv-x="1071.4" />
+<glyph glyph-name="retweet" unicode="&#xe80c;" d="M714 11q0-7-5-13t-13-5h-535q-5 0-8 1t-5 4-3 4-2 7 0 6v335h-107q-15 0-25 11t-11 25q0 13 8 23l179 214q11 12 27 12t28-12l178-214q9-10 9-23 0-15-11-25t-25-11h-107v-214h321q9 0 14-6l89-108q4-5 4-11z m357 232q0-13-8-23l-178-214q-12-13-28-13t-27 13l-179 214q-8 10-8 23 0 14 11 25t25 11h107v214h-322q-9 0-14 7l-89 107q-4 5-4 11 0 7 5 12t13 6h536q4 0 7-1t5-4 3-5 2-6 1-7v-334h107q14 0 25-11t10-25z" horiz-adv-x="1071.4" />

-<glyph glyph-name="search" unicode="&#xe80e;" d="M772 78q30-34 6-62l-46-46q-36-32-68 0l-190 190q-74-42-156-42-128 0-223 95t-95 223 90 219 218 91 224-95 96-223q0-88-46-162z m-678 358q0-88 68-156t156-68 151 63 63 153q0 88-68 155t-156 67-151-63-63-151z" horiz-adv-x="789" />
+<glyph glyph-name="search" unicode="&#xe80d;" d="M772 78q30-34 6-62l-46-46q-36-32-68 0l-190 190q-74-42-156-42-128 0-223 95t-95 223 90 219 218 91 224-95 96-223q0-88-46-162z m-678 358q0-88 68-156t156-68 151 63 63 153q0 88-68 155t-156 67-151-63-63-151z" horiz-adv-x="789" />

-<glyph glyph-name="pin" unicode="&#xe80f;" d="M268 368v250q0 8-5 13t-13 5-13-5-5-13v-250q0-8 5-13t13-5 13 5 5 13z m375-197q0-14-11-25t-25-10h-239l-29-270q-1-7-6-11t-11-5h-1q-15 0-17 15l-43 271h-225q-15 0-25 10t-11 25q0 69 44 124t99 55v286q-29 0-50 21t-22 50 22 50 50 22h357q29 0 50-22t21-50-21-50-50-21v-286q55 0 99-55t44-124z" horiz-adv-x="642.9" />
+<glyph glyph-name="pin" unicode="&#xe80e;" d="M268 368v250q0 8-5 13t-13 5-13-5-5-13v-250q0-8 5-13t13-5 13 5 5 13z m375-197q0-14-11-25t-25-10h-239l-29-270q-1-7-6-11t-11-5h-1q-15 0-17 15l-43 271h-225q-15 0-25 10t-11 25q0 69 44 124t99 55v286q-29 0-50 21t-22 50 22 50 50 22h357q29 0 50-22t21-50-21-50-50-21v-286q55 0 99-55t44-124z" horiz-adv-x="642.9" />

-<glyph glyph-name="cog" unicode="&#xe812;" d="M911 295l-133-56q-8-22-12-31l55-133-79-79-135 53q-9-4-31-12l-55-134-112 0-56 133q-11 4-33 13l-132-55-78 79 53 134q-1 3-4 9t-6 12-4 11l-131 55 0 112 131 56 14 33-54 132 78 79 133-54q22 9 33 13l55 132 112 0 56-132q14-5 31-13l133 55 80-79-54-135q6-12 12-30l133-56 0-112z m-447-111q69 0 118 48t49 118-49 119-118 50-119-50-49-119 49-118 119-48z" horiz-adv-x="928" />
+<glyph glyph-name="cog" unicode="&#xe80f;" d="M911 295l-133-56q-8-22-12-31l55-133-79-79-135 53q-9-4-31-12l-55-134-112 0-56 133q-11 4-33 13l-132-55-78 79 53 134q-1 3-4 9t-6 12-4 11l-131 55 0 112 131 56 14 33-54 132 78 79 133-54q22 9 33 13l55 132 112 0 56-132q14-5 31-13l133 55 80-79-54-135q6-12 12-30l133-56 0-112z m-447-111q69 0 118 48t49 118-49 119-118 50-119-50-49-119 49-118 119-48z" horiz-adv-x="928" />

-<glyph glyph-name="rss-feed" unicode="&#xe813;" d="M184 93c0-51-43-91-93-91s-91 40-91 91c0 50 41 91 91 91s93-41 93-91z m261-85l-125 0c0 174-140 323-315 323l0 118c231 0 440-163 440-441z m259 0l-136 0c0 300-262 561-563 561l0 129c370 0 699-281 699-690z" horiz-adv-x="704" />
+<glyph glyph-name="rss" unicode="&#xe810;" d="M184 93c0-51-43-91-93-91s-91 40-91 91c0 50 41 91 91 91s93-41 93-91z m261-85l-125 0c0 174-140 323-315 323l0 118c231 0 440-163 440-441z m259 0l-136 0c0 300-262 561-563 561l0 129c370 0 699-281 699-690z" horiz-adv-x="704" />
+
+<glyph glyph-name="ok" unicode="&#xe811;" d="M933 534q0-22-16-38l-404-404-76-76q-16-15-38-15t-38 15l-76 76-202 202q-15 16-15 38t15 38l76 76q16 16 38 16t38-16l164-165 366 367q16 16 38 16t38-16l76-76q16-15 16-38z" horiz-adv-x="1000" />
+
+<glyph glyph-name="circle" unicode="&#xf111;" d="M857 350q0-117-57-215t-156-156-215-58-216 58-155 156-58 215 58 215 155 156 216 58 215-58 156-156 57-215z" horiz-adv-x="857.1" />

 <glyph glyph-name="info" unicode="&#xf128;" d="M393 149v-134q0-9-7-15t-15-7h-134q-9 0-16 7t-7 15v134q0 9 7 16t16 6h134q9 0 15-6t7-16z m176 335q0-30-8-56t-20-43-31-33-32-25-34-19q-23-13-38-37t-15-37q0-10-7-18t-16-9h-134q-8 0-14 11t-6 20v26q0 46 37 87t79 60q33 16 47 32t14 42q0 24-26 41t-60 18q-36 0-60-16-20-14-60-64-7-9-17-9-7 0-14 4l-91 70q-8 6-9 14t3 16q89 148 259 148 45 0 90-17t81-46 59-72 23-88z" horiz-adv-x="571.4" />

 <glyph glyph-name="bird" unicode="&#xf309;" d="M920 636q-36-54-94-98l0-24q0-130-60-250t-186-203-290-83q-160 0-290 84 14-2 46-2 132 0 234 80-62 2-110 38t-66 94q10-4 34-4 26 0 50 6-66 14-108 66t-42 120l0 2q36-20 84-24-84 58-84 158 0 48 26 94 154-188 390-196-6 18-6 42 0 78 55 133t135 55q82 0 136-58 60 12 120 44-20-66-82-104 56 8 108 30z" horiz-adv-x="920" />
 </font>
 </defs>
-</svg>
+</svg>
--- a/public/fonts/fontello.ttf
+++ b/public/fonts/fontello.ttf
--- a/public/fonts/fontello.woff
+++ b/public/fonts/fontello.woff
--- a/public/fonts/fontello.woff2
+++ b/public/fonts/fontello.woff2
--- a/src/api.nim
+++ b/src/api.nim
@@ -1,71 +1,102 @@
 # SPDX-License-Identifier: AGPL-3.0-only
-import asyncdispatch, httpclient, uri, strutils, sequtils, sugar
+import asyncdispatch, httpclient, strutils, sequtils, sugar
 import packedjson
 import types, query, formatters, consts, apiutils, parser
 import experimental/parser as newParser

-proc mediaUrl(id: string; cursor: string): SessionAwareUrl =
-  let
-    cookieVariables = userMediaVariables % [id, cursor]
-    oauthVariables = userTweetsVariables % [id, cursor]
-  result = SessionAwareUrl(
-    cookieUrl: graphUserMedia ? {"variables": cookieVariables, "features": gqlFeatures},
-    oauthUrl: graphUserMediaV2 ? {"variables": oauthVariables, "features": gqlFeatures}
+# Helper to generate params object for GraphQL requests
+proc genParams(variables: string; fieldToggles = ""): seq[(string, string)] =
+  result.add ("variables", variables)
+  result.add ("features", gqlFeatures)
+  if fieldToggles.len > 0:
+    result.add ("fieldToggles", fieldToggles)
+
+proc apiUrl(endpoint, variables: string; fieldToggles = ""): ApiUrl =
+  return ApiUrl(endpoint: endpoint, params: genParams(variables, fieldToggles))
+
+proc apiReq(endpoint, variables: string; fieldToggles = ""): ApiReq =
+  let url = apiUrl(endpoint, variables, fieldToggles)
+  return ApiReq(cookie: url, oauth: url)
+
+proc mediaUrl(id: string; cursor: string): ApiReq =
+  result = ApiReq(
+    cookie: apiUrl(graphUserMedia, userMediaVars % [id, cursor]),
+    oauth: apiUrl(graphUserMediaV2, restIdVars % [id, cursor])
+  )
+
+proc userTweetsUrl(id: string; cursor: string): ApiReq =
+  result = ApiReq(
+    # cookie: apiUrl(graphUserTweets, userTweetsVars % [id, cursor], userTweetsFieldToggles),
+    oauth: apiUrl(graphUserTweetsV2, restIdVars % [id, cursor])
+  )
+  # might change this in the future pending testing
+  result.cookie = result.oauth
+
+proc userTweetsAndRepliesUrl(id: string; cursor: string): ApiReq =
+  let cookieVars = userTweetsAndRepliesVars % [id, cursor]
+  result = ApiReq(
+    cookie: apiUrl(graphUserTweetsAndReplies, cookieVars, userTweetsFieldToggles),
+    oauth: apiUrl(graphUserTweetsAndRepliesV2, restIdVars % [id, cursor])
+  )
+
+proc tweetDetailUrl(id: string; cursor: string): ApiReq =
+  let cookieVars = tweetDetailVars % [id, cursor]
+  result = ApiReq(
+    # cookie: apiUrl(graphTweetDetail, cookieVars, tweetDetailFieldToggles),
+    cookie: apiUrl(graphTweet, tweetVars % [id, cursor]),
+    oauth: apiUrl(graphTweet, tweetVars % [id, cursor])
+  )
+
+proc userUrl(username: string): ApiReq =
+  let cookieVars = """{"screen_name":"$1","withGrokTranslatedBio":false}""" % username
+  result = ApiReq(
+    cookie: apiUrl(graphUser, cookieVars, tweetDetailFieldToggles),
+    oauth: apiUrl(graphUserV2, """{"screen_name": "$1"}""" % username)
  )

 proc getGraphUser*(username: string): Future[User] {.async.} =
  if username.len == 0: return
-  let
-    variables = """{"screen_name": "$1"}""" % username
-    params = {"variables": variables, "features": gqlFeatures}
-    js = await fetchRaw(graphUser ? params, Api.userScreenName)
+  let js = await fetchRaw(userUrl(username))
  result = parseGraphUser(js)

 proc getGraphUserById*(id: string): Future[User] {.async.} =
  if id.len == 0 or id.any(c => not c.isDigit): return
  let
-    variables = """{"rest_id": "$1"}""" % id
-    params = {"variables": variables, "features": gqlFeatures}
-    js = await fetchRaw(graphUserById ? params, Api.userRestId)
+    url = apiReq(graphUserById, """{"rest_id": "$1"}""" % id)
+    js = await fetchRaw(url)
  result = parseGraphUser(js)

 proc getGraphUserTweets*(id: string; kind: TimelineKind; after=""): Future[Profile] {.async.} =
  if id.len == 0: return
  let
    cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
-    variables = userTweetsVariables % [id, cursor]
-    params = {"variables": variables, "features": gqlFeatures}
-    js = case kind
-      of TimelineKind.tweets:
-        await fetch(graphUserTweets ? params, Api.userTweets)
-      of TimelineKind.replies:
-        await fetch(graphUserTweetsAndReplies ? params, Api.userTweetsAndReplies)
-      of TimelineKind.media:
-        await fetch(mediaUrl(id, cursor), Api.userMedia)
+    url = case kind
+      of TimelineKind.tweets: userTweetsUrl(id, cursor)
+      of TimelineKind.replies: userTweetsAndRepliesUrl(id, cursor)
+      of TimelineKind.media: mediaUrl(id, cursor)
+    js = await fetch(url)
  result = parseGraphTimeline(js, after)

 proc getGraphListTweets*(id: string; after=""): Future[Timeline] {.async.} =
  if id.len == 0: return
  let
    cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
-    variables = listTweetsVariables % [id, cursor]
-    params = {"variables": variables, "features": gqlFeatures}
-    js = await fetch(graphListTweets ? params, Api.listTweets)
+    url = apiReq(graphListTweets, restIdVars % [id, cursor])
+    js = await fetch(url)
  result = parseGraphTimeline(js, after).tweets

 proc getGraphListBySlug*(name, list: string): Future[List] {.async.} =
  let
    variables = %*{"screenName": name, "listSlug": list}
-    params = {"variables": $variables, "features": gqlFeatures}
-    url = graphListBySlug ? params
-  result = parseGraphList(await fetch(url, Api.listBySlug))
+    url = apiReq(graphListBySlug, $variables)
+    js = await fetch(url)
+  result = parseGraphList(js)

 proc getGraphList*(id: string): Future[List] {.async.} =
-  let
-    variables = """{"listId": "$1"}""" % id
-    params = {"variables": variables, "features": gqlFeatures}
-    url = graphListById ? params
-  result = parseGraphList(await fetch(url, Api.list))
+  let 
+    url = apiReq(graphListById, """{"listId": "$1"}""" % id)
+    js = await fetch(url)
+  result = parseGraphList(js)

 proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.} =
  if list.id.len == 0: return
@@ -79,24 +110,23 @@ proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.}
    }
  if after.len > 0:
    variables["cursor"] = % after
-  let url = graphListMembers ? {"variables": $variables, "features": gqlFeatures}
-  result = parseGraphListMembers(await fetchRaw(url, Api.listMembers), after)
+  let 
+    url = apiReq(graphListMembers, $variables)
+    js = await fetchRaw(url)
+  result = parseGraphListMembers(js, after)

 proc getGraphTweetResult*(id: string): Future[Tweet] {.async.} =
  if id.len == 0: return
  let
-    variables = """{"rest_id": "$1"}""" % id
-    params = {"variables": variables, "features": gqlFeatures}
-    js = await fetch(graphTweetResult ? params, Api.tweetResult)
+    url = apiReq(graphTweetResult, """{"rest_id": "$1"}""" % id)
+    js = await fetch(url)
  result = parseGraphTweetResult(js)

 proc getGraphTweet(id: string; after=""): Future[Conversation] {.async.} =
  if id.len == 0: return
  let
    cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
-    variables = tweetVariables % [id, cursor]
-    params = {"variables": variables, "features": gqlFeatures}
-    js = await fetch(graphTweet ? params, Api.tweetDetail)
+    js = await fetch(tweetDetailUrl(id, cursor))
  result = parseGraphConversation(js, id)

 proc getReplies*(id, after: string): Future[Result[Chain]] {.async.} =
@@ -116,6 +146,7 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
  var
    variables = %*{
      "rawQuery": q,
+      "query_source": "typedQuery",
      "count": 20,
      "product": "Latest",
      "withDownvotePerspective": false,
@@ -124,8 +155,10 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
    }
  if after.len > 0:
    variables["cursor"] = % after
-  let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
-  result = parseGraphSearch[Tweets](await fetch(url, Api.search), after)
+  let 
+    url = apiReq(graphSearchTimeline, $variables)
+    js = await fetch(url)
+  result = parseGraphSearch[Tweets](js, after)
  result.query = query

 proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.} =
@@ -135,6 +168,7 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
  var
    variables = %*{
      "rawQuery": query.text,
+      "query_source": "typedQuery",
      "count": 20,
      "product": "People",
      "withDownvotePerspective": false,
@@ -145,13 +179,15 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
    variables["cursor"] = % after
    result.beginning = false

-  let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
-  result = parseGraphSearch[User](await fetch(url, Api.search), after)
+  let 
+    url = apiReq(graphSearchTimeline, $variables)
+    js = await fetch(url)
+  result = parseGraphSearch[User](js, after)
  result.query = query

 proc getPhotoRail*(id: string): Future[PhotoRail] {.async.} =
  if id.len == 0: return
-  let js = await fetch(mediaUrl(id, ""), Api.userMedia)
+  let js = await fetch(mediaUrl(id, ""))
  result = parseGraphPhotoRail(js)

 proc resolve*(url: string; prefs: Prefs): Future[string] {.async.} =
--- a/src/apiutils.nim
+++ b/src/apiutils.nim
@@ -1,16 +1,37 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 import httpclient, asyncdispatch, options, strutils, uri, times, math, tables
 import jsony, packedjson, zippy, oauth1
-import types, auth, consts, parserutils, http_pool
+import types, auth, consts, parserutils, http_pool, tid
 import experimental/types/common

 const
  rlRemaining = "x-rate-limit-remaining"
  rlReset = "x-rate-limit-reset"
  rlLimit = "x-rate-limit-limit"
-  errorsToSkip = {doesntExist, tweetNotFound, timeout, unauthorized, badRequest}
+  errorsToSkip = {null, doesntExist, tweetNotFound, timeout, unauthorized, badRequest}

-var pool: HttpPool
+var 
+  pool: HttpPool
+  disableTid: bool
+  apiProxy: string
+
+proc setDisableTid*(disable: bool) =
+  disableTid = disable
+
+proc setApiProxy*(url: string) =
+  if url.len > 0:
+    apiProxy = url.strip(chars={'/'}) & "/"
+    if "http" notin apiProxy:
+      apiProxy = "http://" & apiProxy
+
+proc toUrl(req: ApiReq; sessionKind: SessionKind): Uri =
+  case sessionKind
+  of oauth:  
+    let o = req.oauth
+    parseUri("https://api.x.com/graphql")   / o.endpoint ? o.params
+  of cookie: 
+    let c = req.cookie
+    parseUri("https://x.com/i/api/graphql") / c.endpoint ? c.params

 proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
  let
@@ -32,39 +53,49 @@ proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
 proc getCookieHeader(authToken, ct0: string): string =
  "auth_token=" & authToken & "; ct0=" & ct0

-proc genHeaders*(session: Session, url: string): HttpHeaders =
+proc genHeaders*(session: Session, url: Uri): Future[HttpHeaders] {.async.} =
  result = newHttpHeaders({
-    "connection": "keep-alive",
-    "content-type": "application/json",
-    "x-twitter-active-user": "yes",
-    "x-twitter-client-language": "en",
-    "authority": "api.x.com",
+    "accept": "*/*",
    "accept-encoding": "gzip",
    "accept-language": "en-US,en;q=0.9",
-    "accept": "*/*",
-    "DNT": "1",
-    "user-agent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/122.0.0.0 Safari/537.36"
+    "connection": "keep-alive",
+    "content-type": "application/json",
+    "origin": "https://x.com",
+    "user-agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/142.0.0.0 Safari/537.36",
+    "x-twitter-active-user": "yes",
+    "x-twitter-client-language": "en",
+    "priority": "u=1, i"
  })

  case session.kind
  of SessionKind.oauth:
-    result["authorization"] = getOauthHeader(url, session.oauthToken, session.oauthSecret)
+    result["authorization"] = getOauthHeader($url, session.oauthToken, session.oauthSecret)
  of SessionKind.cookie:
-    result["authorization"] = "Bearer AAAAAAAAAAAAAAAAAAAAAFQODgEAAAAAVHTp76lzh3rFzcHbmHVvQxYYpTw%3DckAlMINMjmCwxUcaXbAN4XqJVdgMJaHqNOFgPMK0zN1qLqLQCF"
    result["x-twitter-auth-type"] = "OAuth2Session"
    result["x-csrf-token"] = session.ct0
    result["cookie"] = getCookieHeader(session.authToken, session.ct0)
+    result["sec-ch-ua"] = """"Google Chrome";v="142", "Chromium";v="142", "Not A(Brand";v="24""""
+    result["sec-ch-ua-mobile"] = "?0"
+    result["sec-ch-ua-platform"] = "Windows"
+    result["sec-fetch-dest"] = "empty"
+    result["sec-fetch-mode"] = "cors"
+    result["sec-fetch-site"] = "same-site"
+    if disableTid:
+      result["authorization"] = bearerToken2
+    else:
+      result["authorization"] = bearerToken
+      result["x-client-transaction-id"] = await genTid(url.path)

-proc getAndValidateSession*(api: Api): Future[Session] {.async.} =
-  result = await getSession(api)
+proc getAndValidateSession*(req: ApiReq): Future[Session] {.async.} =
+  result = await getSession(req)
  case result.kind
  of SessionKind.oauth:
    if result.oauthToken.len == 0:
-      echo "[sessions] Empty oauth token, session: ", result.id
+      echo "[sessions] Empty oauth token, session: ", result.pretty
      raise rateLimitError()
  of SessionKind.cookie:
    if result.authToken.len == 0 or result.ct0.len == 0:
-      echo "[sessions] Empty cookie credentials, session: ", result.id
+      echo "[sessions] Empty cookie credentials, session: ", result.pretty
      raise rateLimitError()

 template fetchImpl(result, fetchBody) {.dirty.} =
@@ -73,9 +104,13 @@ template fetchImpl(result, fetchBody) {.dirty.} =

  try:
    var resp: AsyncResponse
-    pool.use(genHeaders(session, $url)):
+    pool.use(await genHeaders(session, url)):
      template getContent =
-        resp = await c.get($url)
+        # TODO: this is a temporary simple implementation
+        if apiProxy.len > 0:
+          resp = await c.get(($url).replace("https://", apiProxy))
+        else:
+          resp = await c.get($url)
        result = await resp.body

      getContent()
@@ -89,7 +124,7 @@ template fetchImpl(result, fetchBody) {.dirty.} =
        remaining = parseInt(resp.headers[rlRemaining])
        reset = parseInt(resp.headers[rlReset])
        limit = parseInt(resp.headers[rlLimit])
-      session.setRateLimit(api, remaining, reset, limit)
+      session.setRateLimit(req, remaining, reset, limit)

    if result.len > 0:
      if resp.headers.getOrDefault("content-encoding") == "gzip":
@@ -98,24 +133,22 @@ template fetchImpl(result, fetchBody) {.dirty.} =
      if result.startsWith("{\"errors"):
        let errors = result.fromJson(Errors)
        if errors notin errorsToSkip:
-          echo "Fetch error, API: ", api, ", errors: ", errors
+          echo "Fetch error, API: ", url.path, ", errors: ", errors
          if errors in {expiredToken, badToken, locked}:
            invalidate(session)
            raise rateLimitError()
          elif errors in {rateLimited}:
            # rate limit hit, resets after 24 hours
-            setLimited(session, api)
+            setLimited(session, req)
            raise rateLimitError()
      elif result.startsWith("429 Too Many Requests"):
-        echo "[sessions] 429 error, API: ", api, ", session: ", session.id
-        session.apis[api].remaining = 0
-        # rate limit hit, resets after the 15 minute window
+        echo "[sessions] 429 error, API: ", url.path, ", session: ", session.pretty
        raise rateLimitError()

    fetchBody

    if resp.status == $Http400:
-      echo "ERROR 400, ", api, ": ", result
+      echo "ERROR 400, ", url.path, ": ", result
      raise newException(InternalError, $url)
  except InternalError as e:
    raise e
@@ -124,8 +157,8 @@ template fetchImpl(result, fetchBody) {.dirty.} =
  except OSError as e:
    raise e
  except Exception as e:
-    let id = if session.isNil: "null" else: $session.id
-    echo "error: ", e.name, ", msg: ", e.msg, ", sessionId: ", id, ", url: ", url
+    let s = session.pretty
+    echo "error: ", e.name, ", msg: ", e.msg, ", session: ", s, ", url: ", url
    raise rateLimitError()
  finally:
    release(session)
@@ -134,19 +167,16 @@ template retry(bod) =
  try:
    bod
  except RateLimitError:
-    echo "[sessions] Rate limited, retrying ", api, " request..."
+    echo "[sessions] Rate limited, retrying ", req.cookie.endpoint, " request..."
    bod

-proc fetch*(url: Uri | SessionAwareUrl; api: Api): Future[JsonNode] {.async.} =
+proc fetch*(req: ApiReq): Future[JsonNode] {.async.} =
  retry:
    var 
      body: string
-      session = await getAndValidateSession(api)
+      session = await getAndValidateSession(req)

-    when url is SessionAwareUrl:
-      let url = case session.kind
-        of SessionKind.oauth: url.oauthUrl
-        of SessionKind.cookie: url.cookieUrl
+    let url = req.toUrl(session.kind)

    fetchImpl body:
      if body.startsWith('{') or body.startsWith('['):
@@ -157,19 +187,15 @@ proc fetch*(url: Uri | SessionAwareUrl; api: Api): Future[JsonNode] {.async.} =

      let error = result.getError
      if error != null and error notin errorsToSkip:
-        echo "Fetch error, API: ", api, ", error: ", error
+        echo "Fetch error, API: ", url.path, ", error: ", error
        if error in {expiredToken, badToken, locked}:
          invalidate(session)
          raise rateLimitError()

-proc fetchRaw*(url: Uri | SessionAwareUrl; api: Api): Future[string] {.async.} =
+proc fetchRaw*(req: ApiReq): Future[string] {.async.} =
  retry:
-    var session = await getAndValidateSession(api)
-
-    when url is SessionAwareUrl:
-      let url = case session.kind
-        of SessionKind.oauth: url.oauthUrl
-        of SessionKind.cookie: url.cookieUrl
+    var session = await getAndValidateSession(req)
+    let url = req.toUrl(session.kind)

    fetchImpl result:
      if not (result.startsWith('{') or result.startsWith('[')):
--- a/src/auth.nim
+++ b/src/auth.nim
@@ -1,26 +1,12 @@
 #SPDX-License-Identifier: AGPL-3.0-only
-import std/[asyncdispatch, times, json, random, sequtils, strutils, tables, packedsets, os]
-import types
+import std/[asyncdispatch, times, json, random, strutils, tables, packedsets, os]
+import types, consts
 import experimental/parser/session

 # max requests at a time per session to avoid race conditions
 const
  maxConcurrentReqs = 2
  hourInSeconds = 60 * 60
-  apiMaxReqs: Table[Api, int] = {
-    Api.search: 50,
-    Api.tweetDetail: 500,
-    Api.userTweets: 500,
-    Api.userTweetsAndReplies: 500,
-    Api.userMedia: 500,
-    Api.userRestId: 500,
-    Api.userScreenName: 500,
-    Api.tweetResult: 500,
-    Api.list: 500,
-    Api.listTweets: 500,
-    Api.listMembers: 500,
-    Api.listBySlug: 500
-  }.toTable

 var
  sessionPool: seq[Session]
@@ -29,6 +15,25 @@ var
 template log(str: varargs[string, `$`]) =
  echo "[sessions] ", str.join("")

+proc endpoint(req: ApiReq; session: Session): string =
+  case session.kind
+  of oauth: req.oauth.endpoint
+  of cookie: req.cookie.endpoint
+
+proc pretty*(session: Session): string =
+  if session.isNil:
+    return "<null>"
+
+  if session.id > 0 and session.username.len > 0:
+    result = $session.id & " (" & session.username & ")"
+  elif session.username.len > 0:
+    result = session.username
+  elif session.id > 0:
+    result = $session.id
+  else:
+    result = "<unknown>"
+  result = $session.kind & " " & result
+
 proc snowflakeToEpoch(flake: int64): int64 =
  int64(((flake shr 22) + 1288834974657) div 1000)

@@ -57,8 +62,7 @@ proc getSessionPoolHealth*(): JsonNode =
    for api in session.apis.keys:
      let
        apiStatus = session.apis[api]
-        limit = if apiStatus.limit > 0: apiStatus.limit else: apiMaxReqs.getOrDefault(api, 0)
-        reqs = limit - apiStatus.remaining
+        reqs = apiStatus.limit - apiStatus.remaining

      # no requests made with this session and endpoint since the limit reset
      if apiStatus.reset < now:
@@ -123,14 +127,15 @@ proc rateLimitError*(): ref RateLimitError =
 proc noSessionsError*(): ref NoSessionsError =
  newException(NoSessionsError, "no sessions available")

-proc isLimited(session: Session; api: Api): bool =
+proc isLimited(session: Session; req: ApiReq): bool =
  if session.isNil:
    return true

-  if session.limited and api != Api.userTweets:
+  let api = req.endpoint(session)
+  if session.limited and api != graphUserTweetsV2:
    if (epochTime().int - session.limitedAt) > hourInSeconds:
      session.limited = false
-      log "resetting limit: ", session.id
+      log "resetting limit: ", session.pretty
      return false
    else:
      return true
@@ -141,12 +146,12 @@ proc isLimited(session: Session; api: Api): bool =
  else:
    return false

-proc isReady(session: Session; api: Api): bool =
-  not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(api))
+proc isReady(session: Session; req: ApiReq): bool =
+  not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(req))

 proc invalidate*(session: var Session) =
  if session.isNil: return
-  log "invalidating: ", session.id
+  log "invalidating: ", session.pretty

  # TODO: This isn't sufficient, but it works for now
  let idx = sessionPool.find(session)
@@ -157,24 +162,26 @@ proc release*(session: Session) =
  if session.isNil: return
  dec session.pending

-proc getSession*(api: Api): Future[Session] {.async.} =
+proc getSession*(req: ApiReq): Future[Session] {.async.} =
  for i in 0 ..< sessionPool.len:
-    if result.isReady(api): break
+    if result.isReady(req): break
    result = sessionPool.sample()

-  if not result.isNil and result.isReady(api):
+  if not result.isNil and result.isReady(req):
    inc result.pending
  else:
-    log "no sessions available for API: ", api
+    log "no sessions available for API: ", req.cookie.endpoint
    raise noSessionsError()

-proc setLimited*(session: Session; api: Api) =
+proc setLimited*(session: Session; req: ApiReq) =
+  let api = req.endpoint(session)
  session.limited = true
  session.limitedAt = epochTime().int
-  log "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", id: ", session.id
+  log "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", ", session.pretty

-proc setRateLimit*(session: Session; api: Api; remaining, reset, limit: int) =
+proc setRateLimit*(session: Session; req: ApiReq; remaining, reset, limit: int) =
  # avoid undefined behavior in race conditions
+  let api = req.endpoint(session)
  if api in session.apis:
    let rateLimit = session.apis[api]
    if rateLimit.reset >= reset and rateLimit.remaining < remaining:
--- a/src/config.nim
+++ b/src/config.nim
@@ -40,7 +40,9 @@ proc getConfig*(path: string): (Config, parseCfg.Config) =
    enableRss: cfg.get("Config", "enableRSS", true),
    enableDebug: cfg.get("Config", "enableDebug", false),
    proxy: cfg.get("Config", "proxy", ""),
-    proxyAuth: cfg.get("Config", "proxyAuth", "")
+    proxyAuth: cfg.get("Config", "proxyAuth", ""),
+    apiProxy: cfg.get("Config", "apiProxy", ""),
+    disableTid: cfg.get("Config", "disableTid", false)
  )

  return (conf, cfg)
--- a/src/consts.nim
+++ b/src/consts.nim
@@ -1,29 +1,36 @@
 # SPDX-License-Identifier: AGPL-3.0-only
-import uri, strutils
+import strutils

 const
  consumerKey* = "3nVuSoBZnx6U4vzUxf5w"
  consumerSecret* = "Bcs59EFbbsdF6Sl9Ng71smgStWEGwXXKSjYvPVt7qys"
+  bearerToken* = "Bearer AAAAAAAAAAAAAAAAAAAAANRILgAAAAAAnNwIzUejRCOuH5E6I8xnZz4puTs%3D1Zv7ttfk8LF81IUq16cHjhLTvJu4FA33AGWWjCpTnA"
+  bearerToken2* = "Bearer AAAAAAAAAAAAAAAAAAAAAFXzAwAAAAAAMHCxpeSDG1gLNLghVe8d74hl6k4%3DRUMF4xAQLsbeBhTSRrCiQpJtxoGWeyHrDb5te2jpGskWDFW82F"

-  gql = parseUri("https://api.x.com") / "graphql"
-
-  graphUser* = gql / "u7wQyGi6oExe8_TRWGMq4Q/UserResultByScreenNameQuery"
-  graphUserById* = gql / "oPppcargziU1uDQHAUmH-A/UserResultByIdQuery"
-  graphUserTweets* = gql / "JLApJKFY0MxGTzCoK6ps8Q/UserWithProfileTweetsQueryV2"
-  graphUserTweetsAndReplies* = gql / "Y86LQY7KMvxn5tu3hFTyPg/UserWithProfileTweetsAndRepliesQueryV2"
-  graphUserMedia* = gql / "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
-  graphUserMediaV2* = gql / "PDfFf8hGeJvUCiTyWtw4wQ/MediaTimelineV2"
-  graphTweet* = gql / "Vorskcd2tZ-tc4Gx3zbk4Q/ConversationTimelineV2"
-  graphTweetResult* = gql / "sITyJdhRPpvpEjg4waUmTA/TweetResultByIdQuery"
-  graphSearchTimeline* = gql / "KI9jCXUx3Ymt-hDKLOZb9Q/SearchTimeline"
-  graphListById* = gql / "oygmAig8kjn0pKsx_bUadQ/ListByRestId"
-  graphListBySlug* = gql / "88GTz-IPPWLn1EiU8XoNVg/ListBySlug"
-  graphListMembers* = gql / "kSmxeqEeelqdHSR7jMnb_w/ListMembers"
-  graphListTweets* = gql / "BbGLL1ZfMibdFNWlk7a0Pw/ListTimeline"
+  graphUser* = "-oaLodhGbbnzJBACb1kk2Q/UserByScreenName"
+  graphUserV2* = "WEoGnYB0EG1yGwamDCF6zg/UserResultByScreenNameQuery"
+  graphUserById* = "VN33vKXrPT7p35DgNR27aw/UserResultByIdQuery"
+  graphUserTweetsV2* = "6QdSuZ5feXxOadEdXa4XZg/UserWithProfileTweetsQueryV2"
+  graphUserTweetsAndRepliesV2* = "BDX77Xzqypdt11-mDfgdpQ/UserWithProfileTweetsAndRepliesQueryV2"
+  graphUserTweets* = "oRJs8SLCRNRbQzuZG93_oA/UserTweets"
+  graphUserTweetsAndReplies* = "kkaJ0Mf34PZVarrxzLihjg/UserTweetsAndReplies"
+  graphUserMedia* = "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
+  graphUserMediaV2* = "bp0e_WdXqgNBIwlLukzyYA/MediaTimelineV2"
+  graphTweet* = "Y4Erk_-0hObvLpz0Iw3bzA/ConversationTimeline"
+  graphTweetDetail* = "YVyS4SfwYW7Uw5qwy0mQCA/TweetDetail"
+  graphTweetResult* = "nzme9KiYhfIOrrLrPP_XeQ/TweetResultByIdQuery"
+  graphSearchTimeline* = "bshMIjqDk8LTXTq4w91WKw/SearchTimeline"
+  graphListById* = "cIUpT1UjuGgl_oWiY7Snhg/ListByRestId"
+  graphListBySlug* = "K6wihoTiTrzNzSF8y1aeKQ/ListBySlug"
+  graphListMembers* = "fuVHh5-gFn8zDBBxb8wOMA/ListMembers"
+  graphListTweets* = "VQf8_XQynI3WzH6xopOMMQ/ListTimeline"

  gqlFeatures* = """{
+  "android_ad_formats_media_component_render_overlay_enabled": false,
  "android_graphql_skip_api_media_color_palette": false,
+  "android_professional_link_spotlight_display_enabled": false,
  "blue_business_profile_image_shape_enabled": false,
+  "commerce_android_shop_module_enabled": false,
  "creator_subscriptions_subscription_count_enabled": false,
  "creator_subscriptions_tweet_preview_api_enabled": true,
  "freedom_of_speech_not_reach_fetch_enabled": true,
@@ -33,8 +40,9 @@ const
  "interactive_text_enabled": false,
  "longform_notetweets_consumption_enabled": true,
  "longform_notetweets_inline_media_enabled": true,
-  "longform_notetweets_richtext_consumption_enabled": true,
  "longform_notetweets_rich_text_read_enabled": true,
+  "longform_notetweets_richtext_consumption_enabled": true,
+  "mobile_app_spotlight_module_enabled": false,
  "responsive_web_edit_tweet_api_enabled": true,
  "responsive_web_enhance_cards_enabled": false,
  "responsive_web_graphql_exclude_directive_enabled": true,
@@ -43,6 +51,7 @@ const
  "responsive_web_media_download_video_enabled": false,
  "responsive_web_text_conversations_enabled": false,
  "responsive_web_twitter_article_tweet_consumption_enabled": true,
+  "unified_cards_destination_url_params_enabled": false,
  "responsive_web_twitter_blue_verified_badge_is_enabled": true,
  "rweb_lists_timeline_redesign_enabled": true,
  "spaces_2022_h2_clipping": true,
@@ -83,11 +92,21 @@ const
  "payments_enabled": false,
  "responsive_web_profile_redirect_enabled": false,
  "responsive_web_grok_show_grok_translated_post": false,
-  "responsive_web_grok_community_note_auto_translation_is_enabled": false
+  "responsive_web_grok_community_note_auto_translation_is_enabled": false,
+  "profile_label_improvements_pcf_label_in_profile_enabled": false,
+  "grok_android_analyze_trend_fetch_enabled": false,
+  "grok_translations_community_note_auto_translation_is_enabled": false,
+  "grok_translations_post_auto_translation_is_enabled": false,
+  "grok_translations_community_note_translation_is_enabled": false,
+  "grok_translations_timeline_user_bio_auto_translation_is_enabled": false,
+  "subscriptions_feature_can_gift_premium": false,
+  "responsive_web_twitter_article_notes_tab_enabled": false,
+  "subscriptions_verification_info_is_identity_verified_enabled": false,
+  "hidden_profile_subscriptions_enabled": false
 }""".replace(" ", "").replace("\n", "")

-  tweetVariables* = """{
-  "focalTweetId": "$1",
+  tweetVars* = """{
+  "postId": "$1",
  $2
  "includeHasBirdwatchNotes": false,
  "includePromotedContent": false,
@@ -96,29 +115,25 @@ const
  "withV2Timeline": true
 }""".replace(" ", "").replace("\n", "")

-#   oldUserTweetsVariables* = """{
-#   "userId": "$1", $2
-#   "count": 20,
-#   "includePromotedContent": false,
-#   "withDownvotePerspective": false,
-#   "withReactionsMetadata": false,
-#   "withReactionsPerspective": false,
-#   "withVoice": false,
-#   "withV2Timeline": true
-# }
-# """
+  tweetDetailVars* = """{
+  "focalTweetId": "$1",
+  $2
+  "referrer": "profile",
+  "with_rux_injections": false,
+  "rankingMode": "Relevance",
+  "includePromotedContent": true,
+  "withCommunity": true,
+  "withQuickPromoteEligibilityTweetFields": true,
+  "withBirdwatchNotes": true,
+  "withVoice": true
+}""".replace(" ", "").replace("\n", "")

-  userTweetsVariables* = """{
+  restIdVars* = """{
  "rest_id": "$1", $2
  "count": 20
 }"""

-  listTweetsVariables* = """{
-  "rest_id": "$1", $2
-  "count": 20
-}"""
-
-  userMediaVariables* = """{
+  userMediaVars* = """{
  "userId": "$1", $2
  "count": 20,
  "includePromotedContent": false,
@@ -126,3 +141,23 @@ const
  "withBirdwatchNotes": false,
  "withVoice": true
 }""".replace(" ", "").replace("\n", "")
+
+  userTweetsVars* = """{
+  "userId": "$1", $2
+  "count": 20,
+  "includePromotedContent": false,
+  "withQuickPromoteEligibilityTweetFields": true,
+  "withVoice": true
+}""".replace(" ", "").replace("\n", "")
+
+  userTweetsAndRepliesVars* = """{
+  "userId": "$1", $2
+  "count": 20,
+  "includePromotedContent": false,
+  "withCommunity": true,
+  "withVoice": true
+}""".replace(" ", "").replace("\n", "")
+
+  userFieldToggles = """{"withPayments":false,"withAuxiliaryUserLabels":true}"""
+  userTweetsFieldToggles* = """{"withArticlePlainText":false}"""
+  tweetDetailFieldToggles* = """{"withArticleRichContentState":true,"withArticlePlainText":false,"withGrokAnalyze":false,"withDisallowedReplyControls":false}"""
--- a/src/experimental/parser/graphql.nim
+++ b/src/experimental/parser/graphql.nim
@@ -1,21 +1,53 @@
-import options
+import options, strutils
 import jsony
-import user, ../types/[graphuser, graphlistmembers]
+import user, utils, ../types/[graphuser, graphlistmembers]
 from ../../types import User, VerifiedType, Result, Query, QueryKind

+proc parseUserResult*(userResult: UserResult): User =
+  result = userResult.legacy
+
+  if result.verifiedType == none and userResult.isBlueVerified:
+    result.verifiedType = blue
+
+  if result.username.len == 0 and userResult.core.screenName.len > 0:
+    result.id = userResult.restId
+    result.username = userResult.core.screenName
+    result.fullname = userResult.core.name
+    result.userPic = userResult.avatar.imageUrl.replace("_normal", "")
+
+    if userResult.privacy.isSome:
+      result.protected = userResult.privacy.get.protected
+
+    if userResult.location.isSome:
+      result.location = userResult.location.get.location
+
+    if userResult.core.createdAt.len > 0:
+      result.joinDate = parseTwitterDate(userResult.core.createdAt)
+
+    if userResult.verification.isSome:
+      let v = userResult.verification.get
+      if v.verifiedType != VerifiedType.none:
+        result.verifiedType = v.verifiedType
+
+    if userResult.profileBio.isSome and result.bio.len == 0:
+      result.bio = userResult.profileBio.get.description
+
 proc parseGraphUser*(json: string): User =
  if json.len == 0 or json[0] != '{':
    return

-  let raw = json.fromJson(GraphUser)
+  let 
+    raw = json.fromJson(GraphUser)
+    userResult = 
+      if raw.data.userResult.isSome: raw.data.userResult.get.result
+      elif raw.data.user.isSome: raw.data.user.get.result
+      else: UserResult()

-  if raw.data.userResult.result.unavailableReason.get("") == "Suspended":
+  if userResult.unavailableReason.get("") == "Suspended" or
+     userResult.reason.get("") == "Suspended":
    return User(suspended: true)

-  result = raw.data.userResult.result.legacy
-  result.id = raw.data.userResult.result.restId
-  if result.verifiedType == VerifiedType.none and raw.data.userResult.result.isBlueVerified:
-    result.verifiedType = blue
+  result = parseUserResult(userResult)

 proc parseGraphListMembers*(json, cursor: string): Result[User] =
  result = Result[User](
@@ -31,7 +63,7 @@ proc parseGraphListMembers*(json, cursor: string): Result[User] =
        of TimelineTimelineItem:
          let userResult = entry.content.itemContent.userResults.result
          if userResult.restId.len > 0:
-            result.content.add userResult.legacy
+            result.content.add parseUserResult(userResult)
        of TimelineTimelineCursor:
          if entry.content.cursorType == "Bottom":
            result.bottom = entry.content.value
--- a/src/experimental/parser/session.nim
+++ b/src/experimental/parser/session.nim
@@ -13,6 +13,7 @@ proc parseSession*(raw: string): Session =
    result = Session(
      kind: SessionKind.oauth,
      id: parseBiggestInt(id),
+      username: session.username,
      oauthToken: session.oauthToken,
      oauthSecret: session.oauthTokenSecret
    )
@@ -21,6 +22,7 @@ proc parseSession*(raw: string): Session =
    result = Session(
      kind: SessionKind.cookie,
      id: id,
+      username: session.username,
      authToken: session.authToken,
      ct0: session.ct0
    )
--- a/src/experimental/parser/tid.nim
+++ b/src/experimental/parser/tid.nim
@@ -0,0 +1,8 @@
+import jsony
+import ../types/tid
+export TidPair
+
+proc parseTidPairs*(raw: string): seq[TidPair] =
+  result = raw.fromJson(seq[TidPair])
+  if result.len == 0:
+    raise newException(ValueError, "Parsing pairs failed: " & raw)
--- a/src/experimental/parser/unifiedcard.nim
+++ b/src/experimental/parser/unifiedcard.nim
@@ -1,6 +1,7 @@
 import std/[options, tables, strutils, strformat, sugar]
 import jsony
 import user, ../types/unifiedcard
+import ../../formatters
 from ../../types import Card, CardKind, Video
 from ../../utils import twimg, https

@@ -77,6 +78,18 @@ proc parseMedia(component: Component; card: UnifiedCard; result: var Card) =
  of model3d:
    result.title = "Unsupported 3D model ad"

+proc parseGrokShare(data: ComponentData; card: UnifiedCard; result: var Card) =
+  result.kind = summaryLarge
+
+  data.destination.parseDestination(card, result)
+  result.dest = "Answer by Grok"
+
+  for msg in data.conversationPreview:
+    if msg.sender == "USER":
+      result.title = msg.message.shorten(70)
+    elif msg.sender == "AGENT":
+      result.text = msg.message.shorten(500)
+
 proc parseUnifiedCard*(json: string): Card =
  let card = json.fromJson(UnifiedCard)

@@ -92,6 +105,8 @@ proc parseUnifiedCard*(json: string): Card =
      component.parseMedia(card, result)
    of buttonGroup:
      discard
+    of grokShare:
+      component.data.parseGrokShare(card, result)
    of ComponentType.jobDetails:
      component.data.parseJobDetails(card, result)
    of ComponentType.hidden:
--- a/src/experimental/parser/user.nim
+++ b/src/experimental/parser/user.nim
@@ -58,11 +58,13 @@ proc toUser*(raw: RawUser): User =
    media: raw.mediaCount,
    verifiedType: raw.verifiedType,
    protected: raw.protected,
-    joinDate: parseTwitterDate(raw.createdAt),
    banner: getBanner(raw),
    userPic: getImageUrl(raw.profileImageUrlHttps).replace("_normal", "")
  )

+  if raw.createdAt.len > 0:
+    result.joinDate = parseTwitterDate(raw.createdAt)
+
  if raw.pinnedTweetIdsStr.len > 0:
    result.pinnedTweet = parseBiggestInt(raw.pinnedTweetIdsStr[0])

@@ -72,21 +74,3 @@ proc parseHook*(s: string; i: var int; v: var User) =
  var u: RawUser
  parseHook(s, i, u)
  v = toUser u
-
-proc parseUser*(json: string; username=""): User =
-  handleErrors:
-    case error.code
-    of suspended: return User(username: username, suspended: true)
-    of userNotFound: return
-    else: echo "[error - parseUser]: ", error
-
-  result = json.fromJson(User)
-
-proc parseUsers*(json: string; after=""): Result[User] =
-  result = Result[User](beginning: after.len == 0)
-
-  # starting with '{' means it's an error
-  if json[0] == '[':
-    let raw = json.fromJson(seq[RawUser])
-    for user in raw:
-      result.content.add user.toUser
--- a/src/experimental/types/graphuser.nim
+++ b/src/experimental/types/graphuser.nim
@@ -1,15 +1,48 @@
-import options
-from ../../types import User
+import options, strutils
+from ../../types import User, VerifiedType

 type
  GraphUser* = object
-    data*: tuple[userResult: UserData]
+    data*: tuple[userResult: Option[UserData], user: Option[UserData]]

  UserData* = object
    result*: UserResult

-  UserResult = object
+  UserCore* = object
+    name*: string
+    screenName*: string
+    createdAt*: string
+
+  UserBio* = object
+    description*: string
+
+  UserAvatar* = object
+    imageUrl*: string
+
+  Verification* = object
+    verifiedType*: VerifiedType
+
+  Location* = object
+    location*: string
+
+  Privacy* = object
+    protected*: bool
+
+  UserResult* = object
    legacy*: User
    restId*: string
    isBlueVerified*: bool
+    core*: UserCore
+    avatar*: UserAvatar
    unavailableReason*: Option[string]
+    reason*: Option[string]
+    privacy*: Option[Privacy]
+    profileBio*: Option[UserBio]
+    verification*: Option[Verification]
+    location*: Option[Location]
+
+proc enumHook*(s: string; v: var VerifiedType) =
+  v = try:
+    parseEnum[VerifiedType](s)
+  except:
+    VerifiedType.none
--- a/src/experimental/types/session.nim
+++ b/src/experimental/types/session.nim
@@ -1,8 +1,8 @@
 type
  RawSession* = object
    kind*: string
-    username*: string
    id*: string
+    username*: string
    oauthToken*: string
    oauthTokenSecret*: string
    authToken*: string
--- a/src/experimental/types/tid.nim
+++ b/src/experimental/types/tid.nim
@@ -0,0 +1,4 @@
+type
+  TidPair* = object
+    animationKey*: string
+    verification*: string
--- a/src/experimental/types/timeline.nim
+++ b/src/experimental/types/timeline.nim
@@ -1,23 +0,0 @@
-import std/tables
-from ../../types import User
-
-type
-  Search* = object
-    globalObjects*: GlobalObjects
-    timeline*: Timeline
-
-  GlobalObjects = object
-    users*: Table[string, User]
-
-  Timeline = object
-    instructions*: seq[Instructions]
-
-  Instructions = object
-    addEntries*: tuple[entries: seq[Entry]]
-
-  Entry = object
-    entryId*: string
-    content*: tuple[operation: Operation]
-
-  Operation = object
-    cursor*: tuple[value, cursorType: string]
--- a/src/experimental/types/unifiedcard.nim
+++ b/src/experimental/types/unifiedcard.nim
@@ -22,6 +22,7 @@ type
    communityDetails
    mediaWithDetailsHorizontal
    hidden
+    grokShare
    unknown

  Component* = object
@@ -42,6 +43,7 @@ type
    topicDetail*: tuple[title: Text]
    profileUser*: User
    shortDescriptionText*: string
+    conversationPreview*: seq[GrokConversation]

  MediaItem* = object
    id*: string
@@ -76,6 +78,10 @@ type
    title*: Text
    category*: Text

+  GrokConversation* = object
+    message*: string
+    sender*: string
+
  TypeField = Component | Destination | MediaEntity | AppStoreData

 converter fromText*(text: Text): string = string(text)
@@ -96,6 +102,7 @@ proc enumHook*(s: string; v: var ComponentType) =
      of "community_details": communityDetails
      of "media_with_details_horizontal": mediaWithDetailsHorizontal
      of "commerce_drop_details": hidden
+      of "grok_share": grokShare
      else: echo "ERROR: Unknown enum value (ComponentType): ", s; unknown

 proc enumHook*(s: string; v: var AppType) =
--- a/src/formatters.nim
+++ b/src/formatters.nim
@@ -1,12 +1,12 @@
 # SPDX-License-Identifier: AGPL-3.0-only
-import strutils, strformat, times, uri, tables, xmltree, htmlparser, htmlgen
+import strutils, strformat, times, uri, tables, xmltree, htmlparser, htmlgen, math
 import std/[enumerate, re]
 import types, utils, query

 const
  cards = "cards.twitter.com/cards"
  tco = "https://t.co"
-  twitter = parseUri("https://twitter.com")
+  twitter = parseUri("https://x.com")

 let
  twRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?twitter\.com"
@@ -33,10 +33,13 @@ proc getUrlPrefix*(cfg: Config): string =
  if cfg.useHttps: https & cfg.hostname
  else: "http://" & cfg.hostname

-proc shortLink*(text: string; length=28): string =
-  result = text.replace(wwwRegex, "")
+proc shorten*(text: string; length=28): string =
+  result = text
  if result.len > length:
    result = result[0 ..< length] & "…"
+
+proc shortLink*(text: string; length=28): string =
+  result = text.replace(wwwRegex, "").shorten(length)
    
 proc stripHtml*(text: string; shorten=false): string =
  var html = parseHtml(text)
@@ -56,25 +59,28 @@ proc replaceUrls*(body: string; prefs: Prefs; absolute=""): string =
  result = body

  if prefs.replaceYouTube.len > 0 and "youtu" in result:
-    result = result.replace(ytRegex, prefs.replaceYouTube)
+    let youtubeHost = strip(prefs.replaceYouTube, chars={'/'})
+    result = result.replace(ytRegex, youtubeHost)

  if prefs.replaceTwitter.len > 0:
+    let twitterHost = strip(prefs.replaceTwitter, chars={'/'})
    if tco in result:
-      result = result.replace(tco, https & prefs.replaceTwitter & "/t.co")
+      result = result.replace(tco, https & twitterHost & "/t.co")
    if "x.com" in result:
-      result = result.replace(xRegex, prefs.replaceTwitter)
+      result = result.replace(xRegex, twitterHost)
      result = result.replacef(xLinkRegex, a(
-        prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
+        twitterHost & "$2", href = https & twitterHost & "$1"))
    if "twitter.com" in result:
-      result = result.replace(cards, prefs.replaceTwitter & "/cards")
-      result = result.replace(twRegex, prefs.replaceTwitter)
+      result = result.replace(cards, twitterHost & "/cards")
+      result = result.replace(twRegex, twitterHost)
      result = result.replacef(twLinkRegex, a(
-        prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
+        twitterHost & "$2", href = https & twitterHost & "$1"))

  if prefs.replaceReddit.len > 0 and ("reddit.com" in result or "redd.it" in result):
-    result = result.replace(rdShortRegex, prefs.replaceReddit & "/comments/")
-    result = result.replace(rdRegex, prefs.replaceReddit)
-    if prefs.replaceReddit in result and "/gallery/" in result:
+    let redditHost = strip(prefs.replaceReddit, chars={'/'})
+    result = result.replace(rdShortRegex, redditHost & "/comments/")
+    result = result.replace(rdRegex, redditHost)
+    if redditHost in result and "/gallery/" in result:
      result = result.replace("/gallery/", "/comments/")

  if absolute.len > 0 and "href" in result:
@@ -148,6 +154,17 @@ proc getShortTime*(tweet: Tweet): string =
  else:
    result = "now"

+proc getDuration*(video: Video): string =
+  let 
+    ms = video.durationMs
+    sec = int(round(ms / 1000))
+    min = floorDiv(sec, 60)
+    hour = floorDiv(min, 60)
+  if hour > 0:
+    return &"{hour}:{min mod 60}:{sec mod 60:02}"
+  else:
+    return &"{min mod 60}:{sec mod 60:02}"
+
 proc getLink*(tweet: Tweet; focus=true): string =
  if tweet.id == 0: return
  var username = tweet.user.username
--- a/src/nitter.nim
+++ b/src/nitter.nim
@@ -6,7 +6,7 @@ from os import getEnv

 import jester

-import types, config, prefs, formatters, redis_cache, http_pool, auth
+import types, config, prefs, formatters, redis_cache, http_pool, auth, apiutils
 import views/[general, about]
 import routes/[
  preferences, timeline, status, media, search, rss, list, debug,
@@ -37,6 +37,8 @@ setHmacKey(cfg.hmacKey)
 setProxyEncoding(cfg.base64Media)
 setMaxHttpConns(cfg.httpMaxConns)
 setHttpProxy(cfg.proxy, cfg.proxyAuth)
+setApiProxy(cfg.apiProxy)
+setDisableTid(cfg.disableTid)
 initAboutPage(cfg.staticDir)

 waitFor initRedisPool(cfg)
--- a/src/parser.nim
+++ b/src/parser.nim
@@ -1,10 +1,10 @@
 # SPDX-License-Identifier: AGPL-3.0-only
-import strutils, options, times, math
+import strutils, options, times, math, tables
 import packedjson, packedjson/deserialiser
 import types, parserutils, utils
 import experimental/parser/unifiedcard

-proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet
+proc parseGraphTweet(js: JsonNode): Tweet

 proc parseUser(js: JsonNode; id=""): User =
  if js.isNull: return
@@ -21,11 +21,16 @@ proc parseUser(js: JsonNode; id=""): User =
    tweets: js{"statuses_count"}.getInt,
    likes: js{"favourites_count"}.getInt,
    media: js{"media_count"}.getInt,
-    verifiedType: parseEnum[VerifiedType](js{"verified_type"}.getStr("None")),
-    protected: js{"protected"}.getBool,
+    protected: js{"protected"}.getBool(js{"privacy", "protected"}.getBool),
    joinDate: js{"created_at"}.getTime
  )

+  if js{"is_blue_verified"}.getBool(false):
+    result.verifiedType = blue
+
+  with verifiedType, js{"verified_type"}:
+    result.verifiedType = parseEnum[VerifiedType](verifiedType.getStr)
+
  result.expandUserEntities(js)

 proc parseGraphUser(js: JsonNode): User =
@@ -41,17 +46,20 @@ proc parseGraphUser(js: JsonNode): User =

  result = parseUser(user{"legacy"}, user{"rest_id"}.getStr)

+  if result.verifiedType == none and user{"is_blue_verified"}.getBool(false):
+    result.verifiedType = blue
+
  # fallback to support UserMedia/recent GraphQL updates
-  if result.username.len == 0 and user{"core", "screen_name"}.notNull:
+  if result.username.len == 0:
    result.username = user{"core", "screen_name"}.getStr
    result.fullname = user{"core", "name"}.getStr
    result.userPic = user{"avatar", "image_url"}.getImageStr.replace("_normal", "")

    if user{"is_blue_verified"}.getBool(false):
      result.verifiedType = blue
-    elif user{"verification", "verified_type"}.notNull:
-      let verifiedType = user{"verification", "verified_type"}.getStr("None")
-      result.verifiedType = parseEnum[VerifiedType](verifiedType)
+
+    with verifiedType, user{"verification", "verified_type"}:
+      result.verifiedType = parseEnum[VerifiedType](verifiedType.getStr)

 proc parseGraphList*(js: JsonNode): List =
  if js.isNull: return
@@ -90,16 +98,24 @@ proc parsePoll(js: JsonNode): Poll =
  result.leader = result.values.find(max(result.values))
  result.votes = result.values.sum

-proc parseGif(js: JsonNode): Gif =
-  result = Gif(
-    url: js{"video_info", "variants"}[0]{"url"}.getImageStr,
-    thumb: js{"media_url_https"}.getImageStr
-  )
+proc parseVideoVariants(variants: JsonNode): seq[VideoVariant] =
+  result = @[]
+  for v in variants:
+    let
+      url = v{"url"}.getStr
+      contentType = parseEnum[VideoType](v{"content_type"}.getStr("video/mp4"))
+      bitrate = v{"bit_rate"}.getInt(v{"bitrate"}.getInt(0))
+
+    result.add VideoVariant(
+      contentType: contentType,
+      bitrate: bitrate,
+      url: url,
+      resolution: if contentType == mp4: getMp4Resolution(url) else: 0
+    )

 proc parseVideo(js: JsonNode): Video =
  result = Video(
    thumb: js{"media_url_https"}.getImageStr,
-    views: getVideoViewCount(js),
    available: true,
    title: js{"ext_alt_text"}.getStr,
    durationMs: js{"video_info", "duration_millis"}.getInt
@@ -116,17 +132,62 @@ proc parseVideo(js: JsonNode): Video =
  with description, js{"additional_media_info", "description"}:
    result.description = description.getStr

-  for v in js{"video_info", "variants"}:
-    let
-      contentType = parseEnum[VideoType](v{"content_type"}.getStr("summary"))
-      url = v{"url"}.getStr
+  result.variants = parseVideoVariants(js{"video_info", "variants"})

-    result.variants.add VideoVariant(
-      contentType: contentType,
-      bitrate: v{"bitrate"}.getInt,
-      url: url,
-      resolution: if contentType == mp4: getMp4Resolution(url) else: 0
-    )
+proc parseLegacyMediaEntities(js: JsonNode; result: var Tweet) =
+  with jsMedia, js{"extended_entities", "media"}:
+    for m in jsMedia:
+      case m.getTypeName:
+      of "photo":
+        result.photos.add m{"media_url_https"}.getImageStr
+      of "video":
+        result.video = some(parseVideo(m))
+        with user, m{"additional_media_info", "source_user"}:
+          if user{"id"}.getInt > 0:
+            result.attribution = some(parseUser(user))
+          else:
+            result.attribution = some(parseGraphUser(user))
+      of "animated_gif":
+        result.gif = some Gif(
+          url: m{"video_info", "variants"}[0]{"url"}.getImageStr,
+          thumb: m{"media_url_https"}.getImageStr
+        )
+      else: discard
+
+      with url, m{"url"}:
+        if result.text.endsWith(url.getStr):
+          result.text.removeSuffix(url.getStr)
+          result.text = result.text.strip()
+
+proc parseMediaEntities(js: JsonNode; result: var Tweet) =
+  with mediaEntities, js{"media_entities"}:
+    for mediaEntity in mediaEntities:
+      with mediaInfo, mediaEntity{"media_results", "result", "media_info"}:
+        case mediaInfo.getTypeName
+        of "ApiImage":
+          result.photos.add mediaInfo{"original_img_url"}.getImageStr
+        of "ApiVideo":
+          let status = mediaEntity{"media_results", "result", "media_availability_v2", "status"}
+          result.video = some Video(
+            available: status.getStr == "Available",
+            thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr,
+            durationMs: mediaInfo{"duration_millis"}.getInt,
+            variants: parseVideoVariants(mediaInfo{"variants"})
+          )
+        of "ApiGif":
+          result.gif = some Gif(
+            url: mediaInfo{"variants"}[0]{"url"}.getImageStr,
+            thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr
+          )
+        else: discard
+
+  # Remove media URLs from text
+  with mediaList, js{"legacy", "entities", "media"}:
+    for url in mediaList:
+      let expandedUrl = url.getExpandedUrl
+      if result.text.endsWith(expandedUrl):
+        result.text.removeSuffix(expandedUrl)
+        result.text = result.text.strip()

 proc parsePromoVideo(js: JsonNode): Video =
  result = Video(
@@ -206,7 +267,7 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =

  for u in ? urls:
    if u{"url"}.getStr == result.url:
-      result.url = u{"expanded_url"}.getStr
+      result.url = u.getExpandedUrl(result.url)
      break

  if kind in {videoDirectMessage, imageDirectMessage}:
@@ -218,12 +279,17 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =

 proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
  if js.isNull: return
+
+  let time =
+    if js{"created_at"}.notNull: js{"created_at"}.getTime
+    else: js{"created_at_ms"}.getTimeFromMs
+
  result = Tweet(
    id: js{"id_str"}.getId,
    threadId: js{"conversation_id_str"}.getId,
    replyId: js{"in_reply_to_status_id_str"}.getId,
    text: js{"full_text"}.getStr,
-    time: js{"created_at"}.getTime,
+    time: time,
    hasThread: js{"self_thread"}.notNull,
    available: true,
    user: User(id: js{"user_id_str"}.getStr),
@@ -231,7 +297,7 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
      replies: js{"reply_count"}.getInt,
      retweets: js{"retweet_count"}.getInt,
      likes: js{"favorite_count"}.getInt,
-      quotes: js{"quote_count"}.getInt
+      views: js{"views_count"}.getInt
    )
  )

@@ -256,6 +322,12 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
      result.retweet = some parseGraphTweet(rt)
      return

+  with reposts, js{"repostedStatusResults"}:
+    with rt, reposts{"result"}:
+      if "legacy" in rt:
+        result.retweet = some parseGraphTweet(rt)
+        return
+
  if jsCard.kind != JNull:
    let name = jsCard{"name"}.getStr
    if "poll" in name:
@@ -269,27 +341,7 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
      result.card = some parseCard(jsCard, js{"entities", "urls"})

  result.expandTweetEntities(js)
-
-  with jsMedia, js{"extended_entities", "media"}:
-    for m in jsMedia:
-      case m{"type"}.getStr
-      of "photo":
-        result.photos.add m{"media_url_https"}.getImageStr
-      of "video":
-        result.video = some(parseVideo(m))
-        with user, m{"additional_media_info", "source_user"}:
-          if user{"id"}.getInt > 0:
-            result.attribution = some(parseUser(user))
-          else:
-            result.attribution = some(parseGraphUser(user))
-      of "animated_gif":
-        result.gif = some(parseGif(m))
-      else: discard
-
-      with url, m{"url"}:
-        if result.text.endsWith(url.getStr):
-          result.text.removeSuffix(url.getStr)
-          result.text = result.text.strip()
+  parseLegacyMediaEntities(js, result)

  with jsWithheld, js{"withheld_in_countries"}:
    let withheldInCountries: seq[string] =
@@ -305,91 +357,108 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
      result.text.removeSuffix(" Learn more.")
      result.available = false

-proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet =
+proc parseGraphTweet(js: JsonNode): Tweet =
  if js.kind == JNull:
    return Tweet()

-  case js{"__typename"}.getStr
+  case js.getTypeName:
  of "TweetUnavailable":
    return Tweet()
  of "TweetTombstone":
-    with text, js{"tombstone", "richText"}:
-      return Tweet(text: text.getTombstone)
-    with text, js{"tombstone", "text"}:
+    with text, select(js{"tombstone", "richText"}, js{"tombstone", "text"}):
      return Tweet(text: text.getTombstone)
    return Tweet()
  of "TweetPreviewDisplay":
    return Tweet(text: "You're unable to view this Tweet because it's only available to the Subscribers of the account owner.")
  of "TweetWithVisibilityResults":
-    return parseGraphTweet(js{"tweet"}, isLegacy)
+    return parseGraphTweet(js{"tweet"})
  else:
    discard

  if not js.hasKey("legacy"):
    return Tweet()

-  var jsCard = copy(js{if isLegacy: "card" else: "tweet_card", "legacy"})
+  var jsCard = select(js{"card"}, js{"tweet_card"}, js{"legacy", "tweet_card"})
  if jsCard.kind != JNull:
-    var values = newJObject()
-    for val in jsCard["binding_values"]:
-      values[val["key"].getStr] = val["value"]
-    jsCard["binding_values"] = values
+    let legacyCard = jsCard{"legacy"}
+    if legacyCard.kind != JNull:
+      let bindingArray = legacyCard{"binding_values"}
+      if bindingArray.kind == JArray:
+        var bindingObj: seq[(string, JsonNode)]
+        for item in bindingArray:
+          bindingObj.add((item{"key"}.getStr, item{"value"}))
+        # Create a new card object with flattened structure
+        jsCard = %*{
+          "name": legacyCard{"name"},
+          "url": legacyCard{"url"},
+          "binding_values": %bindingObj
+        }

  result = parseTweet(js{"legacy"}, jsCard)
  result.id = js{"rest_id"}.getId
  result.user = parseGraphUser(js{"core"})

+  if result.replyId == 0:
+    result.replyId = js{"reply_to_results", "rest_id"}.getId
+
+  with count, js{"views", "count"}:
+    result.stats.views = count.getStr("0").parseInt
+
  with noteTweet, js{"note_tweet", "note_tweet_results", "result"}:
    result.expandNoteTweetEntities(noteTweet)

+  parseMediaEntities(js, result)
+
  if result.quote.isSome:
-    result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}, isLegacy))
+    result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}))
+
+  with quoted, js{"quotedPostResults", "result"}:
+    result.quote = some(parseGraphTweet(quoted))

 proc parseGraphThread(js: JsonNode): tuple[thread: Chain; self: bool] =
-  for t in js{"content", "items"}:
-    let entryId = t{"entryId"}.getStr
+  for t in ? js{"content", "items"}:
+    let entryId = t.getEntryId
    if "cursor-showmore" in entryId:
      let cursor = t{"item", "content", "value"}
      result.thread.cursor = cursor.getStr
      result.thread.hasMore = true
    elif "tweet" in entryId and "promoted" notin entryId:
-      let
-        isLegacy = t{"item"}.hasKey("itemContent")
-        (contentKey, resultKey) = if isLegacy: ("itemContent", "tweet_results")
-                                  else: ("content", "tweetResult")
+      with tweet, t.getTweetResult("item"):
+        result.thread.content.add parseGraphTweet(tweet)

-      with content, t{"item", contentKey}:
-        result.thread.content.add parseGraphTweet(content{resultKey, "result"}, isLegacy)
-
-        if content{"tweetDisplayType"}.getStr == "SelfThread":
+        let tweetDisplayType = select(
+          t{"item", "content", "tweet_display_type"},
+          t{"item", "itemContent", "tweetDisplayType"}
+        )
+        if tweetDisplayType.getStr == "SelfThread":
          result.self = true

 proc parseGraphTweetResult*(js: JsonNode): Tweet =
  with tweet, js{"data", "tweet_result", "result"}:
-    result = parseGraphTweet(tweet, false)
+    result = parseGraphTweet(tweet)

-proc parseGraphConversation*(js: JsonNode; tweetId: string; v2=true): Conversation =
+proc parseGraphConversation*(js: JsonNode; tweetId: string): Conversation =
  result = Conversation(replies: Result[Chain](beginning: true))

-  let
-    rootKey = if v2: "timeline_response" else: "threaded_conversation_with_injections_v2"
-    contentKey = if v2: "content" else: "itemContent"
-    resultKey = if v2: "tweetResult" else: "tweet_results"
-
-  let instructions = ? js{"data", rootKey, "instructions"}
+  let instructions = ? select(
+    js{"data", "timelineResponse", "instructions"},
+    js{"data", "timeline_response", "instructions"},
+    js{"data", "threaded_conversation_with_injections_v2", "instructions"}
+  )
  if instructions.len == 0:
    return

  for i in instructions:
-    if i{"__typename"}.getStr == "TimelineAddEntries":
+    if i.getTypeName == "TimelineAddEntries":
      for e in i{"entries"}:
-        let entryId = e{"entryId"}.getStr
+        let entryId = e.getEntryId
        if entryId.startsWith("tweet"):
-          with tweetResult, e{"content", contentKey, resultKey, "result"}:
-            let tweet = parseGraphTweet(tweetResult, not v2)
+          let tweetResult = getTweetResult(e)
+          if tweetResult.notNull:
+            let tweet = parseGraphTweet(tweetResult)

            if not tweet.available:
-              tweet.id = parseBiggestInt(entryId.getId())
+              tweet.id = entryId.getId

            if $tweet.id == tweetId:
              result.tweet = tweet
@@ -402,66 +471,67 @@ proc parseGraphConversation*(js: JsonNode; tweetId: string; v2=true): Conversati
          elif thread.content.len > 0:
            result.replies.content.add thread
        elif entryId.startsWith("tombstone"):
-          let id = entryId.getId()
-          let tweet = Tweet(
-            id: parseBiggestInt(id),
-            available: false,
-            text: e{"content", contentKey, "tombstoneInfo", "richText"}.getTombstone
-          )
+          let
+            content = select(e{"content", "content"}, e{"content", "itemContent"})
+            tweet = Tweet(
+              id: entryId.getId,
+              available: false,
+              text: content{"tombstoneInfo", "richText"}.getTombstone
+            )

-          if id == tweetId:
+          if $tweet.id == tweetId:
            result.tweet = tweet
          else:
            result.before.content.add tweet
        elif entryId.startsWith("cursor-bottom"):
-          result.replies.bottom = e{"content", contentKey, "value"}.getStr
+          var cursorValue = select(
+            e{"content", "value"},
+            e{"content", "content", "value"},
+            e{"content", "itemContent", "value"}
+          )
+          result.replies.bottom = cursorValue.getStr

-proc extractTweetsFromEntry*(e: JsonNode; entryId: string): seq[Tweet] =
-  if e{"content", "items"}.notNull:
-    for item in e{"content", "items"}:
-      with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
-        var tweet = parseGraphTweet(tweetResult, false)
-        if not tweet.available:
-          tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
-        result.add tweet
+proc extractTweetsFromEntry*(e: JsonNode): seq[Tweet] =
+  with tweetResult, getTweetResult(e):
+    var tweet = parseGraphTweet(tweetResult)
+    if not tweet.available:
+      tweet.id = e.getEntryId.getId
+    result.add tweet
    return

-  with tweetResult, e{"content", "content", "tweetResult", "result"}:
-    var tweet = parseGraphTweet(tweetResult, false)
-    if not tweet.available:
-      tweet.id = parseBiggestInt(entryId.getId())
-    result.add tweet
+  for item in e{"content", "items"}:
+    with tweetResult, item.getTweetResult("item"):
+      var tweet = parseGraphTweet(tweetResult)
+      if not tweet.available:
+        tweet.id = item.getEntryId.getId
+      result.add tweet

 proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
  result = Profile(tweets: Timeline(beginning: after.len == 0))

-  let instructions =
-    if js{"data", "list"}.notNull:
-      ? js{"data", "list", "timeline_response", "timeline", "instructions"}
-    elif js{"data", "user"}.notNull:
-      ? js{"data", "user", "result", "timeline", "timeline", "instructions"}
-    else:
-      ? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
-
+  let instructions = ? select(
+    js{"data", "list", "timeline_response", "timeline", "instructions"},
+    js{"data", "user", "result", "timeline", "timeline", "instructions"},
+    js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
+  )
  if instructions.len == 0:
    return

  for i in instructions:
-    # TimelineAddToModule instruction is used by UserMedia
    if i{"moduleItems"}.notNull:
      for item in i{"moduleItems"}:
-        with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
-          let tweet = parseGraphTweet(tweetResult, false)
+        with tweetResult, item.getTweetResult("item"):
+          let tweet = parseGraphTweet(tweetResult)
          if not tweet.available:
-            tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
+            tweet.id = item.getEntryId.getId
          result.tweets.content.add tweet
      continue

    if i{"entries"}.notNull:
      for e in i{"entries"}:
-        let entryId = e{"entryId"}.getStr
+        let entryId = e.getEntryId
        if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
-          for tweet in extractTweetsFromEntry(e, entryId):
+          for tweet in extractTweetsFromEntry(e):
            result.tweets.content.add tweet
        elif "-conversation-" in entryId or entryId.startsWith("homeConversation"):
          let (thread, self) = parseGraphThread(e)
@@ -469,36 +539,31 @@ proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
        elif entryId.startsWith("cursor-bottom"):
          result.tweets.bottom = e{"content", "value"}.getStr

-    if after.len == 0 and i{"__typename"}.getStr == "TimelinePinEntry":
-      with tweetResult, i{"entry", "content", "content", "tweetResult", "result"}:
-        let tweet = parseGraphTweet(tweetResult, false)
-        tweet.pinned = true
-        if not tweet.available and tweet.tombstone.len == 0:
-          let entryId = i{"entry", "entryId"}.getEntryId
-          if entryId.len > 0:
-            tweet.id = parseBiggestInt(entryId)
-        result.pinned = some tweet
+    if after.len == 0:
+      if i.getTypeName == "TimelinePinEntry":
+        let tweets = extractTweetsFromEntry(i{"entry"})
+        if tweets.len > 0:
+          var tweet = tweets[0]
+          tweet.pinned = true
+          result.pinned = some tweet

 proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
  result = @[]

-  let instructions =
-    if js{"data", "user"}.notNull:
-      ? js{"data", "user", "result", "timeline", "timeline", "instructions"}
-    else:
-      ? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
-
+  let instructions = select(
+    js{"data", "user", "result", "timeline", "timeline", "instructions"},
+    js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
+  )
  if instructions.len == 0:
    return

  for i in instructions:
-    # TimelineAddToModule instruction is used by MediaTimelineV2
    if i{"moduleItems"}.notNull:
      for item in i{"moduleItems"}:
-        with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
-          let t = parseGraphTweet(tweetResult, false)
+        with tweetResult, item.getTweetResult("item"):
+          let t = parseGraphTweet(tweetResult)
          if not t.available:
-            t.id = parseBiggestInt(item{"entryId"}.getStr.getId())
+            t.id = item.getEntryId.getId

          let photo = extractGalleryPhoto(t)
          if photo.url.len > 0:
@@ -508,14 +573,13 @@ proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
            return
      continue

-    let instrType = i{"type"}.getStr(i{"__typename"}.getStr)
-    if instrType != "TimelineAddEntries":
+    if i.getTypeName != "TimelineAddEntries":
      continue

    for e in i{"entries"}:
-      let entryId = e{"entryId"}.getStr
+      let entryId = e.getEntryId
      if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
-        for t in extractTweetsFromEntry(e, entryId):
+        for t in extractTweetsFromEntry(e):
          let photo = extractGalleryPhoto(t)
          if photo.url.len > 0:
            result.add photo
@@ -526,21 +590,24 @@ proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
 proc parseGraphSearch*[T: User | Tweets](js: JsonNode; after=""): Result[T] =
  result = Result[T](beginning: after.len == 0)

-  let instructions = js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
+  let instructions = select(
+    js{"data", "search", "timeline_response", "timeline", "instructions"},
+    js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
+  )
  if instructions.len == 0:
    return

  for instruction in instructions:
-    let typ = instruction{"type"}.getStr
+    let typ = getTypeName(instruction)
    if typ == "TimelineAddEntries":
      for e in instruction{"entries"}:
-        let entryId = e{"entryId"}.getStr
+        let entryId = e.getEntryId
        when T is Tweets:
          if entryId.startsWith("tweet"):
-            with tweetRes, e{"content", "itemContent", "tweet_results", "result"}:
+            with tweetRes, getTweetResult(e):
              let tweet = parseGraphTweet(tweetRes)
              if not tweet.available:
-                tweet.id = parseBiggestInt(entryId.getId())
+                tweet.id = entryId.getId
              result.content.add tweet
        elif T is User:
          if entryId.startsWith("user"):
--- a/src/parserutils.nim
+++ b/src/parserutils.nim
@@ -36,6 +36,12 @@ template `?`*(js: JsonNode): untyped =
  if j.isNull: return
  j

+template select*(a, b: JsonNode): untyped =
+  if a.notNull: a else: b
+
+template select*(a, b, c: JsonNode): untyped =
+  if a.notNull: a elif b.notNull: b else: c
+
 template with*(ident, value, body): untyped =
  if true:
    let ident {.inject.} = value
@@ -44,8 +50,7 @@ template with*(ident, value, body): untyped =
 template with*(ident; value: JsonNode; body): untyped =
  if true:
    let ident {.inject.} = value
-    # value.notNull causes a compilation error for versions < 1.6.14
-    if notNull(value): body
+    if value.notNull: body

 template getCursor*(js: JsonNode): string =
  js{"content", "operation", "cursor", "value"}.getStr
@@ -54,6 +59,20 @@ template getError*(js: JsonNode): Error =
  if js.kind != JArray or js.len == 0: null
  else: Error(js[0]{"code"}.getInt)

+proc getTweetResult*(js: JsonNode; root="content"): JsonNode =
+  select(
+    js{root, "content", "tweet_results", "result"},
+    js{root, "itemContent", "tweet_results", "result"},
+    js{root, "content", "tweetResult", "result"}
+  )
+
+template getTypeName*(js: JsonNode): string =
+  js{"__typename"}.getStr(js{"type"}.getStr)
+
+template getEntryId*(e: JsonNode): string =
+  e{"entryId"}.getStr(e{"entry_id"}.getStr)
+
+
 template parseTime(time: string; f: static string; flen: int): DateTime =
  if time.len != flen: return
  parse(time, f, utc())
@@ -64,29 +83,24 @@ proc getDateTime*(js: JsonNode): DateTime =
 proc getTime*(js: JsonNode): DateTime =
  parseTime(js.getStr, "ddd MMM dd hh:mm:ss \'+0000\' yyyy", 30)

-proc getId*(id: string): string {.inline.} =
+proc getTimeFromMs*(js: JsonNode): DateTime =
+  let ms = js.getInt(0)
+  if ms == 0: return
+  let seconds = ms div 1000
+  return fromUnix(seconds).utc()
+
+proc getId*(id: string): int64 {.inline.} =
  let start = id.rfind("-")
-  if start < 0: return id
-  id[start + 1 ..< id.len]
+  if start < 0:
+    return parseBiggestInt(id)
+  return parseBiggestInt(id[start + 1 ..< id.len])

 proc getId*(js: JsonNode): int64 {.inline.} =
  case js.kind
-  of JString: return parseBiggestInt(js.getStr("0"))
+  of JString: return js.getStr("0").getId
  of JInt: return js.getBiggestInt()
  else: return 0

-proc getEntryId*(js: JsonNode): string {.inline.} =
-  let entry = js{"entryId"}.getStr
-  if entry.len == 0: return
-
-  if "tweet" in entry or "sq-I-t" in entry:
-    return entry.getId
-  elif "tombstone" in entry:
-    return js{"content", "item", "content", "tombstone", "tweet", "id"}.getStr
-  else:
-    echo "unknown entry: ", entry
-    return
-
 template getStrVal*(js: JsonNode; default=""): string =
  js{"string_value"}.getStr(default)

@@ -98,6 +112,9 @@ proc getImageStr*(js: JsonNode): string =
 template getImageVal*(js: JsonNode): string =
  js{"image_value", "url"}.getImageStr

+template getExpandedUrl*(js: JsonNode; fallback=""): string =
+  js{"expanded_url"}.getStr(js{"url"}.getStr(fallback))
+
 proc getCardUrl*(js: JsonNode; kind: CardKind): string =
  result = js{"website_url"}.getStrVal
  if kind == promoVideoConvo:
@@ -157,19 +174,13 @@ proc getMp4Resolution*(url: string): int =
    # cannot determine resolution (e.g. m3u8/non-mp4 video)
    return 0

-proc getVideoViewCount*(js: JsonNode): string =
-  with stats, js{"ext_media_stats"}:
-    return stats{"view_count"}.getStr($stats{"viewCount"}.getInt)
-
-  return $js{"mediaStats", "viewCount"}.getInt(0)
-
 proc extractSlice(js: JsonNode): Slice[int] =
  result = js["indices"][0].getInt ..< js["indices"][1].getInt

 proc extractUrls(result: var seq[ReplaceSlice]; js: JsonNode;
                 textLen: int; hideTwitter = false) =
  let
-    url = js["expanded_url"].getStr
+    url = js.getExpandedUrl
    slice = js.extractSlice

  if hideTwitter and slice.b.succ >= textLen and url.isTwitterUrl:
@@ -230,7 +241,7 @@ proc expandUserEntities*(user: var User; js: JsonNode) =
    ent = ? js{"entities"}

  with urls, ent{"url", "urls"}:
-    user.website = urls[0]{"expanded_url"}.getStr
+    user.website = urls[0].getExpandedUrl

  var replacements = newSeq[ReplaceSlice]()

@@ -260,7 +271,7 @@ proc expandTextEntities(tweet: Tweet; entities: JsonNode; text: string; textSlic
      replacements.extractUrls(u, textSlice.b, hideTwitter = hasRedundantLink)

      if hasCard and u{"url"}.getStr == get(tweet.card).url:
-        get(tweet.card).url = u{"expanded_url"}.getStr
+        get(tweet.card).url = u.getExpandedUrl

  with media, entities{"media"}:
    for m in media:
--- a/src/query.nim
+++ b/src/query.nim
@@ -6,10 +6,9 @@ import types
 const
  validFilters* = @[
    "media", "images", "twimg", "videos",
-    "native_video", "consumer_video", "pro_video",
+    "native_video", "consumer_video", "spaces",
    "links", "news", "quote", "mentions",
-    "replies", "retweets", "nativeretweets",
-    "verified", "safe"
+    "replies", "retweets", "nativeretweets"
  ]

  emptyQuery* = "include:nativeretweets"
@@ -18,6 +17,11 @@ template `@`(param: string): untyped =
  if param in pms: pms[param]
  else: ""

+proc validateNumber(value: string): string =
+  if value.anyIt(not it.isDigit):
+    return ""
+  return value
+
 proc initQuery*(pms: Table[string, string]; name=""): Query =
  result = Query(
    kind: parseEnum[QueryKind](@"f", tweets),
@@ -26,7 +30,7 @@ proc initQuery*(pms: Table[string, string]; name=""): Query =
    excludes: validFilters.filterIt("e-" & it in pms),
    since: @"since",
    until: @"until",
-    near: @"near"
+    minLikes: validateNumber(@"min_faves")
  )

  if name.len > 0:
@@ -78,8 +82,8 @@ proc genQueryParam*(query: Query): string =
    result &= " since:" & query.since
  if query.until.len > 0:
    result &= " until:" & query.until
-  if query.near.len > 0:
-    result &= &" near:\"{query.near}\" within:15mi"
+  if query.minLikes.len > 0:
+    result &= " min_faves:" & query.minLikes
  if query.text.len > 0:
    if result.len > 0:
      result &= " " & query.text
@@ -103,8 +107,8 @@ proc genQueryUrl*(query: Query): string =
    params.add "since=" & query.since
  if query.until.len > 0:
    params.add "until=" & query.until
-  if query.near.len > 0:
-    params.add "near=" & query.near
+  if query.minLikes.len > 0:
+    params.add "min_faves=" & query.minLikes

  if params.len > 0:
    result &= params.join("&")
--- a/src/routes/media.nim
+++ b/src/routes/media.nim
@@ -52,10 +52,10 @@ proc proxyMedia*(req: jester.Request; url: string): Future[HttpCode] {.async.} =
        ""

    let headers = newHttpHeaders({
-      "Content-Type": res.headers["content-type", 0],
-      "Content-Length": contentLength,
-      "Cache-Control": maxAge,
-      "ETag": hashed
+      "content-type": res.headers["content-type", 0],
+      "content-length": contentLength,
+      "cache-control": maxAge,
+      "etag": hashed
    })

    respond(request, headers)
--- a/src/routes/status.nim
+++ b/src/routes/status.nim
@@ -31,8 +31,6 @@ proc createStatusRouter*(cfg: Config) =
        resp $renderReplies(replies, prefs, getPath())

      let conv = await getTweet(id, getCursor())
-      if conv == nil:
-        echo "nil conv"

      if conv == nil or conv.tweet == nil or conv.tweet.id == 0:
        var error = "Tweet not found"
@@ -68,7 +66,7 @@ proc createStatusRouter*(cfg: Config) =

    get "/@name/@s/@id/@m/?@i?":
      cond @"s" in ["status", "statuses"]
-      cond @"m" in ["video", "photo"]
+      cond @"m" in ["video", "photo", "history"]
      redirect("/$1/status/$2" % [@"name", @"id"])

    get "/@name/statuses/@id/?":
@@ -76,6 +74,6 @@ proc createStatusRouter*(cfg: Config) =

    get "/i/web/status/@id":
      redirect("/i/status/" & @"id")
-      
+
    get "/@name/thread/@id/?":
      redirect("/$1/status/$2" % [@"name", @"id"])
--- a/src/routes/timeline.nim
+++ b/src/routes/timeline.nim
@@ -105,9 +105,16 @@ proc createTimelineRouter*(cfg: Config) =
    get "/intent/user":
      respUserId()

+    get "/intent/follow/?":
+      let username = request.params.getOrDefault("screen_name")
+      if username.len == 0:
+        resp Http400, showError("Missing screen_name parameter", cfg)
+      redirect("/" & username)
+
    get "/@name/?@tab?/?":
      cond '.' notin @"name"
      cond @"name" notin ["pic", "gif", "video", "search", "settings", "login", "intent", "i"]
+      cond @"name".allCharsInSet({'a'..'z', 'A'..'Z', '0'..'9', '_', ','})
      cond @"tab" in ["with_replies", "media", "search", ""]
      let
        prefs = cookiePrefs()
--- a/src/routes/unsupported.nim
+++ b/src/routes/unsupported.nim
@@ -17,7 +17,7 @@ proc createUnsupportedRouter*(cfg: Config) =
    get "/@name/lists/?": feature()

    get "/intent/?@i?": 
-      cond @"i" notin ["user"]
+      cond @"i" notin ["user", "follow"]
      feature()

    get "/i/@i?/?@j?":
--- a/src/sass/general.scss
+++ b/src/sass/general.scss
@@ -1,39 +1,40 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 .panel-container {
-    margin: auto;
-    font-size: 130%;
+  margin: auto;
+  font-size: 130%;
 }

 .error-panel {
-    @include center-panel(var(--error_red));
-    text-align: center;
+  @include center-panel(var(--error_red));
+  text-align: center;
 }

 .search-bar > form {
-    @include center-panel(var(--darkest_grey));
+  @include center-panel(var(--darkest_grey));

-    button {
-        background: var(--bg_elements);
-        color: var(--fg_color);
-        border: 0;
-        border-radius: 3px;
-        cursor: pointer;
-        font-weight: bold;
-        width: 30px;
-        height: 30px;
-    }
+  button {
+    background: var(--bg_elements);
+    color: var(--fg_color);
+    border: 0;
+    border-radius: 3px;
+    cursor: pointer;
+    font-weight: bold;
+    width: 30px;
+    height: 30px;
+    padding: 0px 5px 1px 8px;
+  }

-    input {
-        font-size: 16px;
-        width: 100%;
-        background: var(--bg_elements);
-        color: var(--fg_color);
-        border: 0;
-        border-radius: 4px;
-        padding: 4px;
-        margin-right: 8px;
-        height: unset;
-    }
+  input {
+    font-size: 16px;
+    width: 100%;
+    background: var(--bg_elements);
+    color: var(--fg_color);
+    border: 0;
+    border-radius: 4px;
+    padding: 4px;
+    margin-right: 8px;
+    height: unset;
+  }
 }
--- a/src/sass/include/_mixins.css
+++ b/src/sass/include/_mixins.css
@@ -66,18 +66,7 @@
        }

        #search-panel-toggle:checked ~ .search-panel {
-            @if $rows == 6 {
-                max-height: 200px !important;
-            }
-            @if $rows == 5 {
-                max-height: 300px !important;
-            }
-            @if $rows == 4 {
-                max-height: 300px !important;
-            }
-            @if $rows == 3 {
-                max-height: 365px !important;
-            }
+            max-height: 380px !important;
        }
    }
 }
--- a/src/sass/include/_variables.scss
+++ b/src/sass/include/_variables.scss
@@ -1,46 +1,43 @@
 // colors
-$bg_color: #0F0F0F;
-$fg_color: #F8F8F2;
-$fg_faded: #F8F8F2CF;
-$fg_dark: #FF6C60;
-$fg_nav: #FF6C60;
+$bg_color: #0f0f0f;
+$fg_color: #f8f8f2;
+$fg_faded: #f8f8f2cf;
+$fg_dark: #ff6c60;
+$fg_nav: #ff6c60;

 $bg_panel: #161616;
 $bg_elements: #121212;
-$bg_overlays: #1F1F1F;
-$bg_hover: #1A1A1A;
+$bg_overlays: #1f1f1f;
+$bg_hover: #1a1a1a;

 $grey: #888889;
 $dark_grey: #404040;
 $darker_grey: #282828;
 $darkest_grey: #222222;
-$border_grey: #3E3E35;
+$border_grey: #3e3e35;

-$accent: #FF6C60;
-$accent_light: #FFACA0;
-$accent_dark: #8A3731;
-$accent_border: #FF6C6091;
+$accent: #ff6c60;
+$accent_light: #ffaca0;
+$accent_dark: #8a3731;
+$accent_border: #ff6c6091;

-$play_button: #D8574D;
-$play_button_hover: #FF6C60;
+$play_button: #d8574d;
+$play_button_hover: #ff6c60;

-$more_replies_dots: #AD433B;
-$error_red: #420A05;
+$more_replies_dots: #ad433b;
+$error_red: #420a05;

-$verified_blue: #1DA1F2;
-$verified_business: #FAC82B;
-$verified_government: #C1B6A4;
+$verified_blue: #1da1f2;
+$verified_business: #fac82b;
+$verified_government: #c1b6a4;
 $icon_text: $fg_color;

 $tab: $fg_color;
 $tab_selected: $accent;

-$shadow: rgba(0,0,0,.6);
-$shadow_dark: rgba(0,0,0,.2);
+$shadow: rgba(0, 0, 0, 0.6);
+$shadow_dark: rgba(0, 0, 0, 0.2);

 //fonts
-$font_0: Helvetica Neue;
-$font_1: Helvetica;
-$font_2: Arial;
-$font_3: sans-serif;
-$font_4: fontello;
+$font_0: sans-serif;
+$font_1: fontello;
--- a/src/sass/index.scss
+++ b/src/sass/index.scss
@@ -1,180 +1,202 @@
-@import '_variables';
+@import "_variables";

-@import 'tweet/_base';
-@import 'profile/_base';
-@import 'general';
-@import 'navbar';
-@import 'inputs';
-@import 'timeline';
-@import 'search';
+@import "tweet/_base";
+@import "profile/_base";
+@import "general";
+@import "navbar";
+@import "inputs";
+@import "timeline";
+@import "search";

 body {
-    // colors
-    --bg_color: #{$bg_color};
-    --fg_color: #{$fg_color};
-    --fg_faded: #{$fg_faded};
-    --fg_dark: #{$fg_dark};
-    --fg_nav: #{$fg_nav};
+  // colors
+  --bg_color: #{$bg_color};
+  --fg_color: #{$fg_color};
+  --fg_faded: #{$fg_faded};
+  --fg_dark: #{$fg_dark};
+  --fg_nav: #{$fg_nav};

-    --bg_panel: #{$bg_panel};
-    --bg_elements: #{$bg_elements};
-    --bg_overlays: #{$bg_overlays};
-    --bg_hover: #{$bg_hover};
+  --bg_panel: #{$bg_panel};
+  --bg_elements: #{$bg_elements};
+  --bg_overlays: #{$bg_overlays};
+  --bg_hover: #{$bg_hover};

-    --grey: #{$grey};
-    --dark_grey: #{$dark_grey};
-    --darker_grey: #{$darker_grey};
-    --darkest_grey: #{$darkest_grey};
-    --border_grey: #{$border_grey};
+  --grey: #{$grey};
+  --dark_grey: #{$dark_grey};
+  --darker_grey: #{$darker_grey};
+  --darkest_grey: #{$darkest_grey};
+  --border_grey: #{$border_grey};

-    --accent: #{$accent};
-    --accent_light: #{$accent_light};
-    --accent_dark: #{$accent_dark};
-    --accent_border: #{$accent_border};
+  --accent: #{$accent};
+  --accent_light: #{$accent_light};
+  --accent_dark: #{$accent_dark};
+  --accent_border: #{$accent_border};

-    --play_button: #{$play_button};
-    --play_button_hover: #{$play_button_hover};
+  --play_button: #{$play_button};
+  --play_button_hover: #{$play_button_hover};

-    --more_replies_dots: #{$more_replies_dots};
-    --error_red: #{$error_red};
+  --more_replies_dots: #{$more_replies_dots};
+  --error_red: #{$error_red};

-    --verified_blue: #{$verified_blue};
-    --verified_business: #{$verified_business};
-    --verified_government: #{$verified_government};
-    --icon_text: #{$icon_text};
+  --verified_blue: #{$verified_blue};
+  --verified_business: #{$verified_business};
+  --verified_government: #{$verified_government};
+  --icon_text: #{$icon_text};

-    --tab: #{$fg_color};
-    --tab_selected: #{$accent};
+  --tab: #{$fg_color};
+  --tab_selected: #{$accent};

-    --profile_stat: #{$fg_color};
+  --profile_stat: #{$fg_color};

-    background-color: var(--bg_color);
-    color: var(--fg_color);
-    font-family: $font_0, $font_1, $font_2, $font_3;
-    font-size: 14px;
-    line-height: 1.3;
-    margin: 0;
+  background-color: var(--bg_color);
+  color: var(--fg_color);
+  font-family: $font_0, $font_1;
+  font-size: 15px;
+  line-height: 1.3;
+  margin: 0;
 }

 * {
-    outline: unset;
-    margin: 0;
-    text-decoration: none;
+  outline: unset;
+  margin: 0;
+  text-decoration: none;
 }

 h1 {
-    display: inline;
+  display: inline;
 }

-h2, h3 {
-    font-weight: normal;
+h2,
+h3 {
+  font-weight: normal;
 }

 p {
-    margin: 14px 0;
+  margin: 14px 0;
 }

 a {
-    color: var(--accent);
+  color: var(--accent);

-    &:hover {
-        text-decoration: underline;
-    }
+  &:hover {
+    text-decoration: underline;
+  }
 }

 fieldset {
-    border: 0;
-    padding: 0;
-    margin-top: -0.6em;
+  border: 0;
+  padding: 0;
+  margin-top: -0.6em;
 }

 legend {
-    width: 100%;
-    padding: .6em 0 .3em 0;
-    border: 0;
-    font-size: 16px;
-    font-weight: 600;
-    border-bottom: 1px solid var(--border_grey);
-    margin-bottom: 8px;
+  width: 100%;
+  padding: 0.6em 0 0.3em 0;
+  border: 0;
+  font-size: 16px;
+  font-weight: 600;
+  border-bottom: 1px solid var(--border_grey);
+  margin-bottom: 8px;
 }

 .preferences .note {
-    border-top: 1px solid var(--border_grey);
-    border-bottom: 1px solid var(--border_grey);
-    padding: 6px 0 8px 0;
-    margin-bottom: 8px;
-    margin-top: 16px;
+  border-top: 1px solid var(--border_grey);
+  border-bottom: 1px solid var(--border_grey);
+  padding: 6px 0 8px 0;
+  margin-bottom: 8px;
+  margin-top: 16px;
 }

 ul {
-    padding-left: 1.3em;
+  padding-left: 1.3em;
 }

 .container {
-    display: flex;
-    flex-wrap: wrap;
-    box-sizing: border-box;
-    padding-top: 50px;
-    margin: auto;
-    min-height: 100vh;
+  display: flex;
+  flex-wrap: wrap;
+  box-sizing: border-box;
+  padding-top: 50px;
+  margin: auto;
+  min-height: 100vh;
 }

 .icon-container {
-    display: inline;
+  display: inline;
 }

 .overlay-panel {
-    max-width: 600px;
-    width: 100%;
-    margin: 0 auto;
-    margin-top: 10px;
-    background-color: var(--bg_overlays);
-    padding: 10px 15px;
-    align-self: start;
+  max-width: 600px;
+  width: 100%;
+  margin: 0 auto;
+  margin-top: 10px;
+  background-color: var(--bg_overlays);
+  padding: 10px 15px;
+  align-self: start;

-    ul {
-        margin-bottom: 14px;
-    }
+  ul {
+    margin-bottom: 14px;
+  }

-    p {
-        word-break: break-word;
-    }
+  p {
+    word-break: break-word;
+  }
 }

 .verified-icon {
-    color: var(--icon_text);
-    border-radius: 50%;
-    flex-shrink: 0;
-    margin: 2px 0 3px 3px;
-    padding-top: 3px;
-    height: 11px;
-    width: 14px;
-    font-size: 8px;
-    display: inline-block;
-    text-align: center;
-    vertical-align: middle;
+  display: inline-block;
+  width: 14px;
+  height: 14px;
+  margin-left: 2px;

-    &.blue {
-        background-color: var(--verified_blue);
+  .verified-icon-circle {
+    position: absolute;
+    font-size: 15px;
+  }
+
+  .verified-icon-check {
+    position: absolute;
+    font-size: 9px;
+    margin: 5px 3px;
+  }
+
+  &.blue {
+    .verified-icon-circle {
+      color: var(--verified_blue);
    }

-    &.business {
-        color: var(--bg_panel);
-        background-color: var(--verified_business);
+    .verified-icon-check {
+      color: var(--icon_text);
+    }
+  }
+
+  &.business {
+    .verified-icon-circle {
+      color: var(--verified_business);
    }

-    &.government {
-        color: var(--bg_panel);
-        background-color: var(--verified_government);
+    .verified-icon-check {
+      color: var(--bg_panel);
    }
+  }
+
+  &.government {
+    .verified-icon-circle {
+      color: var(--verified_government);
+    }
+
+    .verified-icon-check {
+      color: var(--bg_panel);
+    }
+  }
 }

-@media(max-width: 600px) {
-    .preferences-container {
-        max-width: 95vw;
-    }
+@media (max-width: 600px) {
+  .preferences-container {
+    max-width: 95vw;
+  }

-    .nav-item, .nav-item .icon-container {
-        font-size: 16px;
-    }
+  .nav-item,
+  .nav-item .icon-container {
+    font-size: 16px;
+  }
 }
--- a/src/sass/inputs.scss
+++ b/src/sass/inputs.scss
@@ -1,185 +1,203 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 button {
-    @include input-colors;
-    background-color: var(--bg_elements);
-    color: var(--fg_color);
-    border: 1px solid var(--accent_border);
-    padding: 3px 6px;
-    font-size: 14px;
-    cursor: pointer;
-    float: right;
+  @include input-colors;
+  background-color: var(--bg_elements);
+  color: var(--fg_color);
+  border: 1px solid var(--accent_border);
+  padding: 3px 6px;
+  font-size: 14px;
+  cursor: pointer;
+  float: right;
 }

 input[type="text"],
 input[type="date"],
+input[type="number"],
 select {
-    @include input-colors;
-    background-color: var(--bg_elements);
-    padding: 1px 4px;
-    color: var(--fg_color);
-    border: 1px solid var(--accent_border);
-    border-radius: 0;
-    font-size: 14px;
+  @include input-colors;
+  background-color: var(--bg_elements);
+  padding: 1px 4px;
+  color: var(--fg_color);
+  border: 1px solid var(--accent_border);
+  border-radius: 0;
+  font-size: 14px;
 }

-input[type="text"] {
-    height: 16px;
+input[type="number"] {
+  -moz-appearance: textfield;
+}
+
+input[type="text"],
+input[type="number"] {
+  height: 16px;
 }

 select {
-    height: 20px;
-    padding: 0 2px;
-    line-height: 1;
+  height: 20px;
+  padding: 0 2px;
+  line-height: 1;
 }

 input[type="date"]::-webkit-inner-spin-button {
-    display: none;
+  display: none;
+}
+
+input[type="number"] {
+  -moz-appearance: textfield;
+}
+
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  display: none;
+  -webkit-appearance: none;
+  margin: 0;
 }

 input[type="date"]::-webkit-clear-button {
-    margin-left: 17px;
-    filter: grayscale(100%);
-    filter: hue-rotate(120deg);
+  margin-left: 17px;
+  filter: grayscale(100%);
+  filter: hue-rotate(120deg);
 }

 input::-webkit-calendar-picker-indicator {
-    opacity: 0;
+  opacity: 0;
 }

 input::-webkit-datetime-edit-day-field:focus,
 input::-webkit-datetime-edit-month-field:focus,
 input::-webkit-datetime-edit-year-field:focus {
-    background-color: var(--accent);
-    color: var(--fg_color);
-    outline: none;
+  background-color: var(--accent);
+  color: var(--fg_color);
+  outline: none;
 }

 .date-range {
-    .date-input {
-        display: inline-block;
-        position: relative;
-    }
+  .date-input {
+    display: inline-block;
+    position: relative;
+  }

-    .icon-container {
-        pointer-events: none;
-        position: absolute;
-        top: 2px;
-        right: 5px;
-    }
+  .icon-container {
+    pointer-events: none;
+    position: absolute;
+    top: 2px;
+    right: 5px;
+  }

-    .search-title {
-        margin: 0 2px;
-    }
+  .search-title {
+    margin: 0 2px;
+  }
 }

 .icon-button button {
-    color: var(--accent);
-    text-decoration: none;
-    background: none;
-    border: none;
-    float: none;
-    padding: unset;
-    padding-left: 4px;
+  color: var(--accent);
+  text-decoration: none;
+  background: none;
+  border: none;
+  float: none;
+  padding: unset;
+  padding-left: 4px;

-    &:hover {
-        color: var(--accent_light);
-    }
+  &:hover {
+    color: var(--accent_light);
+  }
 }

 .checkbox {
-    position: absolute;
-    top: 1px;
-    right: 0;
-    height: 17px;
-    width: 17px;
-    background-color: var(--bg_elements);
-    border: 1px solid var(--accent_border);
+  position: absolute;
+  top: 1px;
+  right: 0;
+  height: 17px;
+  width: 17px;
+  background-color: var(--bg_elements);
+  border: 1px solid var(--accent_border);

-    &:after {
-        content: "";
-        position: absolute;
-        display: none;
-    }
+  &:after {
+    content: "";
+    position: absolute;
+    display: none;
+  }
 }

 .checkbox-container {
-    display: block;
-    position: relative;
-    margin-bottom: 5px;
+  display: block;
+  position: relative;
+  margin-bottom: 5px;
+  cursor: pointer;
+  user-select: none;
+  padding-right: 22px;
+
+  input {
+    position: absolute;
+    opacity: 0;
    cursor: pointer;
-    user-select: none;
-    padding-right: 22px;
+    height: 0;
+    width: 0;

-    input {
-        position: absolute;
-        opacity: 0;
-        cursor: pointer;
-        height: 0;
-        width: 0;
-
-        &:checked ~ .checkbox:after {
-            display: block;
-        }
+    &:checked ~ .checkbox:after {
+      display: block;
    }
+  }

-    &:hover input ~ .checkbox {
-        border-color: var(--accent);
-    }
+  &:hover input ~ .checkbox {
+    border-color: var(--accent);
+  }

-    &:active input ~ .checkbox {
-        border-color: var(--accent_light);
-    }
+  &:active input ~ .checkbox {
+    border-color: var(--accent_light);
+  }

-    .checkbox:after {
-        left: 2px;
-        bottom: 0;
-        font-size: 13px;
-        font-family: $font_4;
-        content: '\e803';
-    }
+  .checkbox:after {
+    left: 2px;
+    bottom: 0;
+    font-size: 13px;
+    font-family: $font_1;
+    content: "\e811";
+  }
 }

 .pref-group {
-    display: inline;
+  display: inline;
 }

 .preferences {
-    button {
-        margin: 6px 0 3px 0;
-    }
+  button {
+    margin: 6px 0 3px 0;
+  }

-    label {
-        padding-right: 150px;
-    }
+  label {
+    padding-right: 150px;
+  }

-    select {
-        position: absolute;
-        top: 0;
-        right: 0;
-        display: block;
-        -moz-appearance: none;
-        -webkit-appearance: none;
-        appearance: none;
-    }
+  select {
+    position: absolute;
+    top: 0;
+    right: 0;
+    display: block;
+    -moz-appearance: none;
+    -webkit-appearance: none;
+    appearance: none;
+  }

-    input[type="text"] {
-        position: absolute;
-        right: 0;
-        max-width: 140px;
-    }
+  input[type="text"],
+  input[type="number"] {
+    position: absolute;
+    right: 0;
+    max-width: 140px;
+  }

-    .pref-group {
-        display: block;
-    }
+  .pref-group {
+    display: block;
+  }

-    .pref-input {
-        position: relative;
-        margin-bottom: 6px;
-    }
+  .pref-input {
+    position: relative;
+    margin-bottom: 6px;
+  }

-    .pref-reset {
-        float: left;
-    }
+  .pref-reset {
+    float: left;
+  }
 }
--- a/src/sass/navbar.scss
+++ b/src/sass/navbar.scss
@@ -1,89 +1,87 @@
-@import '_variables';
+@import "_variables";

 nav {
-    display: flex;
-    align-items: center;
-    position: fixed;
-    background-color: var(--bg_overlays);
-    box-shadow: 0 0 4px $shadow;
-    padding: 0;
-    width: 100%;
-    height: 50px;
-    z-index: 1000;
-    font-size: 16px;
+  display: flex;
+  align-items: center;
+  position: fixed;
+  background-color: var(--bg_overlays);
+  box-shadow: 0 0 4px $shadow;
+  padding: 0;
+  width: 100%;
+  height: 50px;
+  z-index: 1000;
+  font-size: 16px;

-    a, .icon-button button {
-        color: var(--fg_nav);
-    }
+  a,
+  .icon-button button {
+    color: var(--fg_nav);
+  }
 }

 .inner-nav {
-    margin: auto;
-    box-sizing: border-box;
-    padding: 0 10px;
-    display: flex;
-    align-items: center;
-    flex-basis: 920px;
-    height: 50px;
+  margin: auto;
+  box-sizing: border-box;
+  padding: 0 10px;
+  display: flex;
+  align-items: center;
+  flex-basis: 920px;
+  height: 50px;
 }

 .site-name {
-    font-size: 15px;
-    font-weight: 600;
-    line-height: 1;
+  font-size: 15px;
+  font-weight: 600;
+  line-height: 1;

-    &:hover {
-        color: var(--accent_light);
-        text-decoration: unset;
-    }
+  &:hover {
+    color: var(--accent_light);
+    text-decoration: unset;
+  }
 }

 .site-logo {
-    display: block;
-    width: 35px;
-    height: 35px;
+  display: block;
+  width: 35px;
+  height: 35px;
 }

 .nav-item {
-    display: flex;
-    flex: 1;
-    line-height: 50px;
-    height: 50px;
-    overflow: hidden;
-    flex-wrap: wrap;
-    align-items: center;
+  display: flex;
+  flex: 1;
+  line-height: 50px;
+  height: 50px;
+  overflow: hidden;
+  flex-wrap: wrap;
+  align-items: center;

-    &.right {
-        text-align: right;
-        justify-content: flex-end;
-    }
+  &.right {
+    text-align: right;
+    justify-content: flex-end;
+  }

-    &.right a {
-        padding-left: 4px;
-
-        &:hover {
-            color: var(--accent_light);
-            text-decoration: unset;
-        }
-    }
+  &.right a:hover {
+    color: var(--accent_light);
+    text-decoration: unset;
+  }
 }

 .lp {
-    height: 14px;
-    display: inline-block;
-    position: relative;
-    top: 2px;
-    fill: var(--fg_nav);
+  height: 14px;
+  display: inline-block;
+  position: relative;
+  top: 2px;
+  fill: var(--fg_nav);

-    &:hover {
-        fill: var(--accent_light);
-    }
+  &:hover {
+    fill: var(--accent_light);
+  }
 }

-.icon-info:before {
-    margin: 0 -3px;
+.icon-info {
+  margin: 0 -3px;
 }

 .icon-cog {
-    font-size: 15px;
+  font-size: 15px;
+  padding-left: 0 !important;
 }
--- a/src/sass/search.scss
+++ b/src/sass/search.scss
@@ -1,122 +1,120 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 .search-title {
-    font-weight: bold;
-    display: inline-block;
-    margin-top: 4px;
+  font-weight: bold;
+  display: inline-block;
+  margin-top: 4px;
 }

 .search-field {
+  display: flex;
+  flex-wrap: wrap;
+
+  button {
+    margin: 0 2px 0 0;
+    padding: 0px 1px 1px 4px;
+    height: 23px;
    display: flex;
-    flex-wrap: wrap;
+    align-items: center;
+  }

-    button {
-        margin: 0 2px 0 0;
-        height: 23px;
-        display: flex;
-        align-items: center;
-    }
+  .pref-input {
+    margin: 0 4px 0 0;
+    flex-grow: 1;
+    height: 23px;
+  }

-    .pref-input {
-        margin: 0 4px 0 0;
-        flex-grow: 1;
-        height: 23px;
-    }
+  input[type="text"],
+  input[type="number"] {
+    height: calc(100% - 4px);
+    width: calc(100% - 8px);
+  }

-    input[type="text"] {
-        height: calc(100% - 4px);
-        width: calc(100% - 8px);
-    }
+  > label {
+    display: inline;
+    background-color: var(--bg_elements);
+    color: var(--fg_color);
+    border: 1px solid var(--accent_border);
+    padding: 1px 1px 2px 4px;
+    font-size: 14px;
+    cursor: pointer;
+    margin-bottom: 2px;

-    > label {
-        display: inline;
-        background-color: var(--bg_elements);
-        color: var(--fg_color);
-        border: 1px solid var(--accent_border);
-        padding: 1px 6px 2px 6px;
-        font-size: 14px;
-        cursor: pointer;
-        margin-bottom: 2px;
+    @include input-colors;
+  }

-        @include input-colors;
-    }
-
-    @include create-toggle(search-panel, 200px);
+  @include create-toggle(search-panel, 380px);
 }

 .search-panel {
-    width: 100%;
-    max-height: 0;
-    overflow: hidden;
-    transition: max-height 0.4s;
+  width: 100%;
+  max-height: 0;
+  overflow: hidden;
+  transition: max-height 0.4s;

-    flex-grow: 1;
-    font-weight: initial;
-    text-align: left;
+  flex-grow: 1;
+  font-weight: initial;
+  text-align: left;

-    > div {
-        line-height: 1.7em;
-    }
+  .checkbox-container {
+    display: inline;
+    padding-right: unset;
+    margin-bottom: 5px;
+    margin-left: 23px;
+  }

-    .checkbox-container {
-        display: inline;
-        padding-right: unset;
-        margin-bottom: unset;
-        margin-left: 23px;
-    }
+  .checkbox {
+    right: unset;
+    left: -22px;
+    line-height: 1.6em;
+  }

-    .checkbox {
-        right: unset;
-        left: -22px;
-    }
-
-    .checkbox-container .checkbox:after {
-        top: -4px;
-    }
+  .checkbox-container .checkbox:after {
+    top: -4px;
+  }
 }

 .search-row {
-    display: flex;
-    flex-wrap: wrap;
-    line-height: unset;
+  display: flex;
+  flex-wrap: wrap;
+  line-height: unset;

-    > div {
-        flex-grow: 1;
-        flex-shrink: 1;
-    }
+  > div {
+    flex-grow: 1;
+    flex-shrink: 1;
+  }
+
+  input {
+    height: 21px;
+  }
+
+  .pref-input {
+    display: block;
+    padding-bottom: 5px;

    input {
-        height: 21px;
-    }
-
-    .pref-input {
-        display: block;
-        padding-bottom: 5px;
-
-        input {
-            height: 21px;
-            margin-top: 1px;
-        }
+      height: 21px;
+      margin-top: 1px;
    }
+  }
 }

 .search-toggles {
-    flex-grow: 1;
-    display: grid;
-    grid-template-columns: repeat(6, auto);
-    grid-column-gap: 10px;
+  flex-grow: 1;
+  display: grid;
+  grid-template-columns: repeat(5, auto);
+  grid-column-gap: 10px;
 }

 .profile-tabs {
-    @include search-resize(820px, 5);
-    @include search-resize(725px, 4);
-    @include search-resize(600px, 6);
-    @include search-resize(560px, 5);
-    @include search-resize(480px, 4);
-    @include search-resize(410px, 3);
+  @include search-resize(820px, 5);
+  @include search-resize(715px, 4);
+  @include search-resize(700px, 5);
+  @include search-resize(485px, 4);
+  @include search-resize(410px, 3);
 }

-@include search-resize(560px, 5);
-@include search-resize(480px, 4);
+@include search-resize(700px, 5);
+@include search-resize(485px, 4);
@include search-resize(410px, 3);
--- a/src/sass/timeline.scss
+++ b/src/sass/timeline.scss
@@ -1,162 +1,162 @@
-@import '_variables';
+@import "_variables";

 .timeline-container {
-    @include panel(100%, 600px);
+  @include panel(100%, 600px);
 }

 .timeline {
-    background-color: var(--bg_panel);
+  background-color: var(--bg_panel);

-    > div:not(:first-child) {
-        border-top: 1px solid var(--border_grey);
-    }
+  > div:not(:first-child) {
+    border-top: 1px solid var(--border_grey);
+  }
 }

 .timeline-header {
-    width: 100%;
-    background-color: var(--bg_panel);
-    text-align: center;
-    padding: 8px;
-    display: block;
-    font-weight: bold;
-    margin-bottom: 5px;
-    box-sizing: border-box;
+  width: 100%;
+  background-color: var(--bg_panel);
+  text-align: center;
+  padding: 8px;
+  display: block;
+  font-weight: bold;
+  margin-bottom: 5px;
+  box-sizing: border-box;

-    button {
-        float: unset;
-    }
+  button {
+    float: unset;
+  }
 }

 .timeline-banner img {
-    width: 100%;
+  width: 100%;
 }

 .timeline-description {
-    font-weight: normal;
+  font-weight: normal;
 }

 .tab {
-    align-items: center;
-    display: flex;
-    flex-wrap: wrap;
-    list-style: none;
-    margin: 0 0 5px 0;
-    background-color: var(--bg_panel);
-    padding: 0;
+  align-items: center;
+  display: flex;
+  flex-wrap: wrap;
+  list-style: none;
+  margin: 0 0 5px 0;
+  background-color: var(--bg_panel);
+  padding: 0;
 }

 .tab-item {
-    flex: 1 1 0;
-    text-align: center;
-    margin-top: 0;
+  flex: 1 1 0;
+  text-align: center;
+  margin-top: 0;

-    a {
-        border-bottom: .1rem solid transparent;
-        color: var(--tab);
-        display: block;
-        padding: 8px 0;
-        text-decoration: none;
-        font-weight: bold;
+  a {
+    border-bottom: 0.1rem solid transparent;
+    color: var(--tab);
+    display: block;
+    padding: 8px 0;
+    text-decoration: none;
+    font-weight: bold;

-        &:hover {
-            text-decoration: none;
-        }
-
-        &.active {
-            border-bottom-color: var(--tab_selected);
-            color: var(--tab_selected);
-        }
+    &:hover {
+      text-decoration: none;
    }

-    &.active a {
-        border-bottom-color: var(--tab_selected);
-        color: var(--tab_selected);
+    &.active {
+      border-bottom-color: var(--tab_selected);
+      color: var(--tab_selected);
    }
+  }

-    &.wide {
-        flex-grow: 1.2;
-        flex-basis: 50px;
-    }
+  &.active a {
+    border-bottom-color: var(--tab_selected);
+    color: var(--tab_selected);
+  }
+
+  &.wide {
+    flex-grow: 1.2;
+    flex-basis: 50px;
+  }
 }

 .timeline-footer {
-    background-color: var(--bg_panel);
-    padding: 6px 0;
+  background-color: var(--bg_panel);
+  padding: 6px 0;
 }

 .timeline-protected {
-    text-align: center;
+  text-align: center;

-    p {
-        margin: 8px 0;
-    }
+  p {
+    margin: 8px 0;
+  }

-    h2 {
-        color: var(--accent);
-        font-size: 20px;
-        font-weight: 600;
-    }
-}
-
-.timeline-none {
+  h2 {
    color: var(--accent);
    font-size: 20px;
    font-weight: 600;
-    text-align: center;
+  }
+}
+
+.timeline-none {
+  color: var(--accent);
+  font-size: 20px;
+  font-weight: 600;
+  text-align: center;
 }

 .timeline-end {
-    background-color: var(--bg_panel);
-    color: var(--accent);
-    font-size: 16px;
-    font-weight: 600;
-    text-align: center;
+  background-color: var(--bg_panel);
+  color: var(--accent);
+  font-size: 16px;
+  font-weight: 600;
+  text-align: center;
 }

 .show-more {
-    background-color: var(--bg_panel);
-    text-align: center;
-    padding: .75em 0;
-    display: block !important;
+  background-color: var(--bg_panel);
+  text-align: center;
+  padding: 0.75em 0;
+  display: block !important;

-    a {
-        background-color: var(--darkest_grey);
-        display: inline-block;
-        height: 2em;
-        padding: 0 2em;
-        line-height: 2em;
+  a {
+    background-color: var(--darkest_grey);
+    display: inline-block;
+    height: 2em;
+    padding: 0 2em;
+    line-height: 2em;

-        &:hover {
-            background-color: var(--darker_grey);
-        }
+    &:hover {
+      background-color: var(--darker_grey);
    }
+  }
 }

 .top-ref {
-    background-color: var(--bg_color);
-    border-top: none !important;
+  background-color: var(--bg_color);
+  border-top: none !important;

-    .icon-down {
-        font-size: 20px;
-        display: flex;
-        justify-content: center;
-        text-decoration: none;
+  .icon-down {
+    font-size: 20px;
+    display: flex;
+    justify-content: center;
+    text-decoration: none;

-        &:hover {
-            color: var(--accent_light);
-        }
-
-        &::before {
-            transform: rotate(180deg) translateY(-1px);
-        }
+    &:hover {
+      color: var(--accent_light);
    }
+
+    &::before {
+      transform: rotate(180deg) translateY(-1px);
+    }
+  }
 }

 .timeline-item {
-    overflow-wrap: break-word;
-    border-left-width: 0;
-    min-width: 0;
-    padding: .75em;
-    display: flex;
-    position: relative;
+  overflow-wrap: break-word;
+  border-left-width: 0;
+  min-width: 0;
+  padding: 0.75em;
+  display: flex;
+  position: relative;
 }
--- a/src/sass/tweet/_base.scss
+++ b/src/sass/tweet/_base.scss
@@ -1,240 +1,244 @@
-@import '_variables';
-@import '_mixins';
-@import 'thread';
-@import 'media';
-@import 'video';
-@import 'embed';
-@import 'card';
-@import 'poll';
-@import 'quote';
+@import "_variables";
+@import "_mixins";
+@import "thread";
+@import "media";
+@import "video";
+@import "embed";
+@import "card";
+@import "poll";
+@import "quote";

 .tweet-body {
-    flex: 1;
-    min-width: 0;
-    margin-left: 58px;
-    pointer-events: none;
-    z-index: 1;
+  flex: 1;
+  min-width: 0;
+  margin-left: 58px;
+  pointer-events: none;
+  z-index: 1;
 }

 .tweet-content {
-    font-family: $font_3;
-    line-height: 1.3em;
-    pointer-events: all;
-    display: inline;
+  line-height: 1.3em;
+  pointer-events: all;
+  display: inline;
 }

 .tweet-bidi {
-    display: block !important;
+  display: block !important;
 }

 .tweet-header {
-    padding: 0;
-    vertical-align: bottom;
-    flex-basis: 100%;
-    margin-bottom: .2em;
+  padding: 0;
+  vertical-align: bottom;
+  flex-basis: 100%;
+  margin-bottom: 0.2em;

-    a {
-        display: inline-block;
-        word-break: break-all;
-        max-width: 100%;
-        pointer-events: all;
-    }
+  a {
+    display: inline-block;
+    word-break: break-all;
+    max-width: 100%;
+    pointer-events: all;
+  }
 }

 .tweet-name-row {
-    padding: 0;
-    display: flex;
-    justify-content: space-between;
+  padding: 0;
+  display: flex;
+  justify-content: space-between;
 }

 .fullname-and-username {
-    display: flex;
-    min-width: 0;
+  display: flex;
+  min-width: 0;
 }

 .fullname {
-    @include ellipsis;
-    flex-shrink: 2;
-    max-width: 80%;
-    font-size: 14px;
-    font-weight: 700;
-    color: var(--fg_color);
+  @include ellipsis;
+  flex-shrink: 2;
+  max-width: 80%;
+  font-size: 14px;
+  font-weight: 700;
+  color: var(--fg_color);
 }

 .username {
-    @include ellipsis;
-    min-width: 1.6em;
-    margin-left: .4em;
-    word-wrap: normal;
+  @include ellipsis;
+  min-width: 1.6em;
+  margin-left: 0.4em;
+  word-wrap: normal;
 }

 .tweet-date {
-    display: flex;
-    flex-shrink: 0;
-    margin-left: 4px;
+  display: flex;
+  flex-shrink: 0;
+  margin-left: 4px;
 }

-.tweet-date a, .username, .show-more a {
-    color: var(--fg_dark);
+.tweet-date a,
+.username,
+.show-more a {
+  color: var(--fg_dark);
 }

 .tweet-published {
-    margin: 0;
-    margin-top: 5px;
-    color: var(--grey);
-    pointer-events: all;
+  margin: 0;
+  margin-top: 5px;
+  color: var(--grey);
+  pointer-events: all;
 }

 .tweet-avatar {
-    display: contents !important;
+  display: contents !important;

-    img {
-        float: left;
-        margin-top: 3px;
-        margin-left: -58px;
-        width: 48px;
-        height: 48px;
-    }
+  img {
+    float: left;
+    margin-top: 3px;
+    margin-left: -58px;
+    width: 48px;
+    height: 48px;
+  }
 }

 .avatar {
-    &.round {
-        border-radius: 50%;
-        -webkit-user-select: none;
-    }
-    
-    &.mini {
-        position: unset;
-        margin-right: 5px;
-        margin-top: -1px;
-        width: 20px;
-        height: 20px;
-    }
+  &.round {
+    border-radius: 50%;
+    -webkit-user-select: none;
+  }
+
+  &.mini {
+    position: unset;
+    margin-right: 5px;
+    margin-top: -1px;
+    width: 20px;
+    height: 20px;
+  }
 }

 .tweet-embed {
+  display: flex;
+  flex-direction: column;
+  justify-content: center;
+  height: 100%;
+  background-color: var(--bg_panel);
+
+  .tweet-content {
+    font-size: 18px;
+  }
+
+  .tweet-body {
    display: flex;
    flex-direction: column;
-    justify-content: center;
-    height: 100%;
-    background-color: var(--bg_panel);
+    max-height: calc(100vh - 0.75em * 2);
+  }

-    .tweet-content { 
-        font-size: 18px;
-    }
-    
-    .tweet-body {
-        display: flex;
-        flex-direction: column;
-        max-height: calc(100vh - 0.75em * 2);
-    }
+  .card-image img {
+    height: auto;
+  }

-    .card-image img {
-        height: auto;
-    }
-    
-    .avatar {
-        position: absolute;
-    }
+  .avatar {
+    position: absolute;
+  }
 }

 .attribution {
-    display: flex;
-    pointer-events: all;
-    margin: 5px 0;
+  display: flex;
+  pointer-events: all;
+  margin: 5px 0;

-    strong {
-        color: var(--fg_color);
-    }
+  strong {
+    color: var(--fg_color);
+  }
 }

 .media-tag-block {
-    padding-top: 5px;
-    pointer-events: all;
+  padding-top: 5px;
+  pointer-events: all;
+  color: var(--fg_faded);
+
+  .icon-container {
+    padding-right: 2px;
+  }
+
+  .media-tag,
+  .icon-container {
    color: var(--fg_faded);
-
-    .icon-container {
-        padding-right: 2px;
-    }
-
-    .media-tag, .icon-container {
-        color: var(--fg_faded);
-    }
+  }
 }

 .timeline-container .media-tag-block {
-    font-size: 13px;
+  font-size: 13px;
 }

 .tweet-geo {
-    color: var(--fg_faded);
+  color: var(--fg_faded);
 }

 .replying-to {
-    color: var(--fg_faded);
-    margin: -2px 0 4px;
+  color: var(--fg_faded);
+  margin: -2px 0 4px;

-    a {
-        pointer-events: all;
-    }
+  a {
+    pointer-events: all;
+  }
 }

-.retweet-header, .pinned, .tweet-stats {
-    align-content: center;
-    color: var(--grey);
-    display: flex;
-    flex-shrink: 0;
-    flex-wrap: wrap;
-    font-size: 14px;
-    font-weight: 600;
-    line-height: 22px;
+.retweet-header,
+.pinned,
+.tweet-stats {
+  align-content: center;
+  color: var(--grey);
+  display: flex;
+  flex-shrink: 0;
+  flex-wrap: wrap;
+  font-size: 14px;
+  font-weight: 600;
+  line-height: 22px;

-    span {
-        @include ellipsis;
-    }
+  span {
+    @include ellipsis;
+  }
 }

 .retweet-header {
-    margin-top: -5px !important;
+  margin-top: -5px !important;
 }

 .tweet-stats {
-    margin-bottom: -3px;
-    -webkit-user-select: none;
+  margin-bottom: -3px;
+  -webkit-user-select: none;
 }

 .tweet-stat {
-    padding-top: 5px;
-    min-width: 1em;
-    margin-right: 0.8em;
+  padding-top: 5px;
+  min-width: 1em;
+  margin-right: 0.8em;
 }

 .show-thread {
-    display: block;
-    pointer-events: all;
-    padding-top: 2px;
+  display: block;
+  pointer-events: all;
+  padding-top: 2px;
 }

 .unavailable-box {
-    width: 100%;
-    height: 100%;
-    padding: 12px;
-    border: solid 1px var(--dark_grey);
-    box-sizing: border-box;
-    border-radius: 10px;
-    background-color: var(--bg_color);
-    z-index: 2;
+  width: 100%;
+  height: 100%;
+  padding: 12px;
+  border: solid 1px var(--dark_grey);
+  box-sizing: border-box;
+  border-radius: 10px;
+  background-color: var(--bg_color);
+  z-index: 2;
 }

 .tweet-link {
-    height: 100%;
-    width: 100%;
-    left: 0;
-    top: 0;
-    position: absolute;
-    -webkit-user-select: none;
+  height: 100%;
+  width: 100%;
+  left: 0;
+  top: 0;
+  position: absolute;
+  -webkit-user-select: none;

-    &:hover {
-        background-color: var(--bg_hover);
-    }
+  &:hover {
+    background-color: var(--bg_hover);
+  }
 }
--- a/src/sass/tweet/card.scss
+++ b/src/sass/tweet/card.scss
@@ -42,6 +42,7 @@

 .card-description {
    margin: 0.3em 0;
+    white-space: pre-wrap;
 }

 .card-destination {
--- a/src/sass/tweet/embed.scss
+++ b/src/sass/tweet/embed.scss
@@ -1,17 +1,17 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 .embed-video {
-    .gallery-video {
-        width: 100%;
-        height: 100%;
-        position: absolute;
-        background-color: black;
-        top: 0%;
-        left: 0%;
-    }
+  .gallery-video {
+    width: 100%;
+    height: 100%;
+    position: absolute;
+    background-color: black;
+    top: 0%;
+    left: 0%;
+  }

-    .video-container {
-        max-height: unset;
-    }
+  .video-container {
+    max-height: unset;
+  }
 }
--- a/src/sass/tweet/media.scss
+++ b/src/sass/tweet/media.scss
@@ -1,76 +1,76 @@
-@import '_variables';
+@import "_variables";

 .gallery-row {
-    display: flex;
-    flex-direction: row;
-    flex-wrap: nowrap;
-    align-items: center;
-    overflow: hidden;
-    flex-grow: 1;
-    max-height: 379.5px;
-    max-width: 533px;
-    pointer-events: all;
+  display: flex;
+  flex-direction: row;
+  flex-wrap: nowrap;
+  align-items: center;
+  overflow: hidden;
+  flex-grow: 1;
+  max-height: 379.5px;
+  max-width: 533px;
+  pointer-events: all;

-    .still-image {
-        width: 100%;
-        display: flex;
-    }
+  .still-image {
+    width: 100%;
+    display: flex;
+  }
 }

 .attachments {
-    margin-top: .35em;
-    display: flex;
-    flex-direction: row;
-    width: 100%;
-    max-height: 600px;
-    border-radius: 7px;
-    overflow: hidden;
-    flex-flow: column;
-    background-color: var(--bg_color);
-    align-items: center;
-    pointer-events: all;
+  margin-top: 0.35em;
+  display: flex;
+  flex-direction: row;
+  width: 100%;
+  max-height: 600px;
+  border-radius: 7px;
+  overflow: hidden;
+  flex-flow: column;
+  background-color: var(--bg_color);
+  align-items: center;
+  pointer-events: all;

-    .image-attachment {
-        width: 100%;
-    }
+  .image-attachment {
+    width: 100%;
+  }
 }

 .attachment {
-    position: relative;
-    line-height: 0;
-    overflow: hidden;
-    margin: 0 .25em 0 0;
-    flex-grow: 1;
-    box-sizing: border-box;
-    min-width: 2em;
+  position: relative;
+  line-height: 0;
+  overflow: hidden;
+  margin: 0 0.25em 0 0;
+  flex-grow: 1;
+  box-sizing: border-box;
+  min-width: 2em;

-    &:last-child {
-        margin: 0;
-        max-height: 530px;
-    }
+  &:last-child {
+    margin: 0;
+    max-height: 530px;
+  }
 }

 .gallery-gif video {
-    max-height: 530px;
-    background-color: #101010;
+  max-height: 530px;
+  background-color: #101010;
 }

 .still-image {
-    max-height: 379.5px;
-    max-width: 533px;
-    justify-content: center;
+  max-height: 379.5px;
+  max-width: 533px;
+  justify-content: center;

-    img {
-        object-fit: cover;
-        max-width: 100%;
-        max-height: 379.5px;
-        flex-basis: 300px;
-        flex-grow: 1;
-    }
+  img {
+    object-fit: cover;
+    max-width: 100%;
+    max-height: 379.5px;
+    flex-basis: 300px;
+    flex-grow: 1;
+  }
 }

 .image {
-    display: inline-block;
+  display: inline-block;
 }

 // .single-image {
@@ -86,34 +86,34 @@
 // }

 .overlay-circle {
-    border-radius: 50%;
-    background-color: var(--dark_grey);
-    width: 40px;
-    height: 40px;
-    align-items: center;
-    display: flex;
-    border-width: 5px;
-    border-color: var(--play_button);
-    border-style: solid;
+  border-radius: 50%;
+  background-color: var(--dark_grey);
+  width: 40px;
+  height: 40px;
+  align-items: center;
+  display: flex;
+  border-width: 5px;
+  border-color: var(--play_button);
+  border-style: solid;
 }

 .overlay-triangle {
-    width: 0;
-    height: 0;
-    border-style: solid;
-    border-width: 12px 0 12px 17px;
-    border-color: transparent transparent transparent var(--play_button);
-    margin-left: 14px;
+  width: 0;
+  height: 0;
+  border-style: solid;
+  border-width: 12px 0 12px 17px;
+  border-color: transparent transparent transparent var(--play_button);
+  margin-left: 14px;
 }

 .media-gif {
-    display: table;
-    background-color: unset;
-    width: unset;
+  display: table;
+  background-color: unset;
+  width: unset;
 }

 .media-body {
-    flex: 1;
-    padding: 0;
-    white-space: pre-wrap;
+  flex: 1;
+  padding: 0;
+  white-space: pre-wrap;
 }
--- a/src/sass/tweet/poll.scss
+++ b/src/sass/tweet/poll.scss
@@ -1,42 +1,42 @@
-@import '_variables';
+@import "_variables";

 .poll-meter {
-    overflow: hidden;
-    position: relative;
-    margin: 6px 0;
-    height: 26px;
-    background: var(--bg_color);
-    border-radius: 5px;
-    display: flex;
-    align-items: center;
+  overflow: hidden;
+  position: relative;
+  margin: 6px 0;
+  height: 26px;
+  background: var(--bg_color);
+  border-radius: 5px;
+  display: flex;
+  align-items: center;
 }

 .poll-choice-bar {
-    height: 100%;
-    position: absolute;
-    background: var(--dark_grey);
+  height: 100%;
+  position: absolute;
+  background: var(--dark_grey);
 }

 .poll-choice-value {
-    position: relative;
-    font-weight: bold;
-    margin-left: 5px;
-    margin-right: 6px;
-    min-width: 30px;
-    text-align: right;
-    pointer-events: all;
+  position: relative;
+  font-weight: bold;
+  margin-left: 5px;
+  margin-right: 6px;
+  min-width: 30px;
+  text-align: right;
+  pointer-events: all;
 }

 .poll-choice-option {
-    position: relative;
-    pointer-events: all;
+  position: relative;
+  pointer-events: all;
 }

 .poll-info {
-    color: var(--grey);
-    pointer-events: all;
+  color: var(--grey);
+  pointer-events: all;
 }

 .leader .poll-choice-bar {
-    background: var(--accent_dark);
+  background: var(--accent_dark);
 }
--- a/src/sass/tweet/quote.scss
+++ b/src/sass/tweet/quote.scss
@@ -1,94 +1,95 @@
-@import '_variables';
+@import "_variables";

 .quote {
-    margin-top: 10px;
-    border: solid 1px var(--dark_grey);
-    border-radius: 10px;
-    background-color: var(--bg_elements);
+  margin-top: 10px;
+  border: solid 1px var(--dark_grey);
+  border-radius: 10px;
+  background-color: var(--bg_elements);
+  overflow: hidden;
+  pointer-events: all;
+  position: relative;
+  width: 100%;
+
+  &:hover {
+    border-color: var(--grey);
+  }
+
+  &.unavailable:hover {
+    border-color: var(--dark_grey);
+  }
+
+  .tweet-name-row {
+    padding: 6px 8px;
+    margin-top: 1px;
+  }
+
+  .quote-text {
    overflow: hidden;
-    pointer-events: all;
-    position: relative;
-    width: 100%;
+    white-space: pre-wrap;
+    word-wrap: break-word;
+    padding: 0px 8px 8px 8px;
+  }

-    &:hover {
-        border-color: var(--grey);
-    }
+  .show-thread {
+    padding: 0px 8px 6px 8px;
+    margin-top: -6px;
+  }

-    &.unavailable:hover {
-        border-color: var(--dark_grey);
-    }
-
-    .tweet-name-row {
-        padding: 6px 8px;
-        margin-top: 1px;
-    }
-
-    .quote-text {
-        overflow: hidden;
-        white-space: pre-wrap;
-        word-wrap: break-word;
-        padding: 0px 8px 8px 8px;
-    }
-
-    .show-thread {
-        padding: 0px 8px 6px 8px;
-        margin-top: -6px;
-    }
-
-    .replying-to {
-        padding: 0px 8px;
-        margin: unset;
-    }
+  .replying-to {
+    padding: 0px 8px;
+    margin: unset;
+  }
 }

 .unavailable-quote {
-    padding: 12px;
+  padding: 12px;
 }

 .quote-link {
-    width: 100%;
-    height: 100%;
-    left: 0;
-    top: 0;
-    position: absolute;
+  width: 100%;
+  height: 100%;
+  left: 0;
+  top: 0;
+  position: absolute;
 }

 .quote-media-container {
-    max-height: 300px;
+  max-height: 300px;
+  display: flex;
+
+  .card {
+    margin: unset;
+  }
+
+  .attachments {
+    border-radius: 0;
+  }
+
+  .media-gif {
+    width: 100%;
    display: flex;
+    justify-content: center;
+  }

-    .card {
-        margin: unset;
+  .gallery-gif .attachment {
+    display: flex;
+    justify-content: center;
+    background-color: var(--bg_color);
+
+    video {
+      height: unset;
+      width: unset;
+      max-height: 100%;
+      max-width: 100%;
    }
+  }

-    .attachments {
-        border-radius: 0;
-    }
+  .gallery-video,
+  .gallery-gif {
+    max-height: 300px;
+  }

-    .media-gif {
-        width: 100%;
-        display: flex;
-        justify-content: center;
-    }
-
-    .gallery-gif .attachment {
-        display: flex;
-        justify-content: center;
-        background-color: var(--bg_color);
-
-        video {
-            height: unset;
-            width: unset;
-            max-height: 100%;
-            max-width: 100%;
-        }
-    }
-
-    .gallery-video, .gallery-gif {
-        max-height: 300px;
-    }
-
-    .still-image img {
-        max-height: 250px
-    }
+  .still-image img {
+    max-height: 250px;
+  }
 }
--- a/src/sass/tweet/thread.scss
+++ b/src/sass/tweet/thread.scss
@@ -1,138 +1,139 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 .conversation {
-    @include panel(100%, 600px);
+  @include panel(100%, 600px);

-    .show-more {
-        margin-bottom: 10px;
-    }
+  .show-more {
+    margin-bottom: 10px;
+  }
 }

 .main-thread {
-    margin-bottom: 20px;
-    background-color: var(--bg_panel);
+  margin-bottom: 20px;
+  background-color: var(--bg_panel);
 }

-.main-tweet, .replies {
-    padding-top: 50px;
-    margin-top: -50px;
+.main-tweet,
+.replies {
+  padding-top: 50px;
+  margin-top: -50px;
 }

 .main-tweet .tweet-content {
-    font-size: 18px;
+  font-size: 18px;
 }

-@media(max-width: 600px) {
-    .main-tweet .tweet-content {
-        font-size: 16px;
-    }
+@media (max-width: 600px) {
+  .main-tweet .tweet-content {
+    font-size: 16px;
+  }
 }

 .reply {
-    background-color: var(--bg_panel);
-    margin-bottom: 10px;
+  background-color: var(--bg_panel);
+  margin-bottom: 10px;
 }

 .thread-line {
-    .timeline-item::before,
-    &.timeline-item::before {
-        background: var(--accent_dark);
-        content: '';
-        position: relative;
-        min-width: 3px;
-        width: 3px;
-        left: 26px;
-        border-radius: 2px;
-        margin-left: -3px;
-        margin-bottom: 37px;
-        top: 56px;
-        z-index: 1;
-        pointer-events: none;
-    }
+  .timeline-item::before,
+  &.timeline-item::before {
+    background: var(--accent_dark);
+    content: "";
+    position: relative;
+    min-width: 3px;
+    width: 3px;
+    left: 26px;
+    border-radius: 2px;
+    margin-left: -3px;
+    margin-bottom: 37px;
+    top: 56px;
+    z-index: 1;
+    pointer-events: none;
+  }

-    .with-header:not(:first-child)::after {
-        background: var(--accent_dark);
-        content: '';
-        position: relative;
-        float: left;
-        min-width: 3px;
-        width: 3px;
-        right: calc(100% - 26px);
-        border-radius: 2px;
-        margin-left: -3px;
-        margin-bottom: 37px;
-        bottom: 10px;
-        height: 30px;
-        z-index: 1;
-        pointer-events: none;
-    }
+  .with-header:not(:first-child)::after {
+    background: var(--accent_dark);
+    content: "";
+    position: relative;
+    float: left;
+    min-width: 3px;
+    width: 3px;
+    right: calc(100% - 26px);
+    border-radius: 2px;
+    margin-left: -3px;
+    margin-bottom: 37px;
+    bottom: 10px;
+    height: 30px;
+    z-index: 1;
+    pointer-events: none;
+  }

-    .unavailable::before {
-        top: 48px;
-        margin-bottom: 28px;
-    }
+  .unavailable::before {
+    top: 48px;
+    margin-bottom: 28px;
+  }

-    .more-replies::before {
-        content: '...';
-        background: unset;
-        color: var(--more_replies_dots);
-        font-weight: bold;
-        font-size: 20px;
-        line-height: 0.25em;
-        left: 1.2em;
-        width: 5px;
-        top: 2px;
-        margin-bottom: 0;
-        margin-left: -2.5px;
-    }
+  .more-replies::before {
+    content: "...";
+    background: unset;
+    color: var(--more_replies_dots);
+    font-weight: bold;
+    font-size: 20px;
+    line-height: 0.25em;
+    left: 1.2em;
+    width: 5px;
+    top: 2px;
+    margin-bottom: 0;
+    margin-left: -2.5px;
+  }

-    .earlier-replies {
-        padding-bottom: 0;
-        margin-bottom: -5px;
-    }
+  .earlier-replies {
+    padding-bottom: 0;
+    margin-bottom: -5px;
+  }
 }

 .timeline-item.thread-last::before {
-    background: unset;
-    min-width: unset;
-    width: 0;
-    margin: 0;
+  background: unset;
+  min-width: unset;
+  width: 0;
+  margin: 0;
 }

 .more-replies {
-    padding-top: 0.3em !important;
+  padding-top: 0.3em !important;
 }

 .more-replies-text {
-    @include ellipsis;
-    display: block;
-    margin-left: 58px;
-    padding: 7px 0;
+  @include ellipsis;
+  display: block;
+  margin-left: 58px;
+  padding: 7px 0;
 }

 .timeline-item.thread.more-replies-thread {
-    padding: 0 0.75em;
+  padding: 0 0.75em;
+
+  &::before {
+    top: 40px;
+    margin-bottom: 31px;
+  }
+
+  .more-replies {
+    display: flex;
+    padding-top: unset !important;
+    margin-top: 8px;

    &::before {
-        top: 40px;
-        margin-bottom: 31px;
+      display: inline-block;
+      position: relative;
+      top: -1px;
+      line-height: 0.4em;
    }

-    .more-replies {
-        display: flex;
-        padding-top: unset !important;
-        margin-top: 8px;
-
-        &::before {
-            display: inline-block;
-            position: relative;
-            top: -1px;
-            line-height: 0.4em;
-        }
-
-        .more-replies-text {
-            display: inline;
-        }
+    .more-replies-text {
+      display: inline;
    }
+  }
 }
--- a/src/sass/tweet/video.scss
+++ b/src/sass/tweet/video.scss
@@ -1,68 +1,77 @@
-@import '_variables';
-@import '_mixins';
+@import "_variables";
+@import "_mixins";

 video {
-    max-height: 100%;
-    width: 100%;
+  height: 100%;
+  width: 100%;
 }

 .gallery-video {
-    display: flex;
-    overflow: hidden;
+  display: flex;
+  overflow: hidden;
 }

 .gallery-video.card-container {
-    flex-direction: column;
+  flex-direction: column;
+  width: 100%;
 }

 .video-container {
-    min-height: 80px;
-    min-width: 200px;
-    max-height: 530px;
-    margin: 0;
-    display: flex;
-    align-items: center;
-    justify-content: center;
+  min-height: 80px;
+  min-width: 200px;
+  max-height: 530px;
+  margin: 0;

-    img {
-        max-height: 100%;
-        max-width: 100%;
-    }
+  img {
+    max-height: 100%;
+    max-width: 100%;
+  }
 }

 .video-overlay {
-    @include play-button;
-    background-color: $shadow;
+  @include play-button;
+  background-color: $shadow;

-    p {
-        position: relative;
-        z-index: 0;
-        text-align: center;
-        top: calc(50% - 20px);
-        font-size: 20px;
-        line-height: 1.3;
-        margin: 0 20px;
-    }
+  p {
+    position: relative;
+    z-index: 0;
+    text-align: center;
+    top: calc(50% - 20px);
+    font-size: 20px;
+    line-height: 1.3;
+    margin: 0 20px;
+  }

-    div {
-        position: relative;
-        z-index: 0;
-        top: calc(50% - 20px);
-        margin: 0 auto;
-        width: 40px;
-        height: 40px;
-    }
+  .overlay-circle {
+    position: relative;
+    z-index: 0;
+    top: calc(50% - 20px);
+    margin: 0 auto;
+    width: 40px;
+    height: 40px;
+  }

-    form {
-        width: 100%;
-        height: 100%;
-        align-items: center;
-        justify-content: center;
-        display: flex;
-    }
+  .overlay-duration {
+    position: absolute;
+    bottom: 8px;
+    left: 8px;
+    background-color: #0000007a;
+    line-height: 1em;
+    padding: 4px 6px 4px 6px;
+    border-radius: 5px;
+    font-weight: bold;
+  }

-    button {
-        padding: 5px 8px;
-        font-size: 16px;
-    }
+  form {
+    width: 100%;
+    height: 100%;
+    align-items: center;
+    justify-content: center;
+    display: flex;
+  }
+
+  button {
+    padding: 5px 8px;
+    font-size: 16px;
+  }
 }
--- a/src/tid.nim
+++ b/src/tid.nim
@@ -0,0 +1,62 @@
+import std/[asyncdispatch, base64, httpclient, random, strutils, sequtils, times]
+import nimcrypto
+import experimental/parser/tid
+
+randomize()
+
+const defaultKeyword = "obfiowerehiring";
+const pairsUrl =
+  "https://raw.githubusercontent.com/fa0311/x-client-transaction-id-pair-dict/refs/heads/main/pair.json";
+
+var
+  cachedPairs: seq[TidPair] = @[]
+  lastCached = 0
+  # refresh every hour
+  ttlSec = 60 * 60
+
+proc getPair(): Future[TidPair] {.async.} =
+  if cachedPairs.len == 0 or int(epochTime()) - lastCached > ttlSec:
+    lastCached = int(epochTime())
+
+    let client = newAsyncHttpClient()
+    defer: client.close()
+
+    let resp = await client.get(pairsUrl)
+    if resp.status == $Http200:
+      cachedPairs = parseTidPairs(await resp.body)
+
+  return sample(cachedPairs)
+
+proc encodeSha256(text: string): array[32, byte] =
+  let
+    data = cast[ptr byte](addr text[0])
+    dataLen = uint(len(text))
+    digest = sha256.digest(data, dataLen)
+  return digest.data
+
+proc encodeBase64[T](data: T): string =
+  return encode(data).replace("=", "")
+
+proc decodeBase64(data: string): seq[byte] =
+  return cast[seq[byte]](decode(data))
+
+proc genTid*(path: string): Future[string] {.async.} =
+  let 
+    pair = await getPair()
+
+    timeNow = int(epochTime() - 1682924400)
+    timeNowBytes = @[
+      byte(timeNow and 0xff),
+      byte((timeNow shr 8) and 0xff),
+      byte((timeNow shr 16) and 0xff),
+      byte((timeNow shr 24) and 0xff)
+    ]
+
+    data = "GET!" & path & "!" & $timeNow & defaultKeyword & pair.animationKey
+    hashBytes = encodeSha256(data)
+    keyBytes = decodeBase64(pair.verification)
+    bytesArr = keyBytes & timeNowBytes & hashBytes[0 ..< 16] & @[3'u8]
+    randomNum = byte(rand(256))
+    tid = @[randomNum] & bytesArr.mapIt(it xor randomNum)
+
+  return encodeBase64(tid)
--- a/src/types.nim
+++ b/src/types.nim
@@ -1,5 +1,5 @@
 # SPDX-License-Identifier: AGPL-3.0-only
-import times, sequtils, options, tables, uri
+import times, sequtils, options, tables
 import prefs_impl

 genPrefsType()
@@ -13,19 +13,13 @@ type
  TimelineKind* {.pure.} = enum
    tweets, replies, media

-  Api* {.pure.} = enum
-    tweetDetail
-    tweetResult
-    search
-    list
-    listBySlug
-    listMembers
-    listTweets
-    userRestId
-    userScreenName
-    userTweets
-    userTweetsAndReplies
-    userMedia
+  ApiUrl* = object
+    endpoint*: string
+    params*: seq[(string, string)]
+
+  ApiReq* = object
+    oauth*: ApiUrl
+    cookie*: ApiUrl

  RateLimit* = object
    limit*: int
@@ -38,10 +32,11 @@ type

  Session* = ref object
    id*: int64
+    username*: string
    pending*: int
    limited*: bool
    limitedAt*: int
-    apis*: Table[Api, RateLimit]
+    apis*: Table[string, RateLimit]
    case kind*: SessionKind
    of oauth:
      oauthToken*: string
@@ -50,10 +45,6 @@ type
      authToken*: string
      ct0*: string

-  SessionAwareUrl* = object
-    oauthUrl*: Uri
-    cookieUrl*: Uri
-
  Error* = enum
    null = 0
    noUserMatches = 17
@@ -120,7 +111,6 @@ type
    durationMs*: int
    url*: string
    thumb*: string
-    views*: string
    available*: bool
    reason*: string
    title*: string
@@ -140,7 +130,7 @@ type
    fromUser*: seq[string]
    since*: string
    until*: string
-    near*: string
+    minLikes*: string
    sep*: string

  Gif* = object
@@ -201,7 +191,7 @@ type
    replies*: int
    retweets*: int
    likes*: int
-    quotes*: int
+    views*: int

  Tweet* = ref object
    id*: int64
@@ -285,6 +275,8 @@ type
    enableDebug*: bool
    proxy*: string
    proxyAuth*: string
+    apiProxy*: string
+    disableTid*: bool

    rssCacheTime*: int
    listCacheTime*: int
--- a/src/views/general.nim
+++ b/src/views/general.nim
@@ -30,15 +30,15 @@ proc renderNavbar(cfg: Config; req: Request; rss, canonical: string): VNode =
      tdiv(class="nav-item right"):
        icon "search", title="Search", href="/search"
        if cfg.enableRss and rss.len > 0:
-          icon "rss-feed", title="RSS Feed", href=rss
-        icon "bird", title="Open in Twitter", href=canonical
+          icon "rss", title="RSS Feed", href=rss
+        icon "bird", title="Open in X", href=canonical
        a(href="https://liberapay.com/zedeus"): verbatim lp
        icon "info", title="About", href="/about"
        icon "cog", title="Preferences", href=("/settings?referer=" & encodeUrl(path))

 proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
                 video=""; images: seq[string] = @[]; banner=""; ogTitle="";
-                 rss=""; canonical=""): VNode =
+                 rss=""; alternate=""): VNode =
  var theme = prefs.theme.toTheme
  if "theme" in req.params:
    theme = req.params["theme"].toTheme
@@ -52,8 +52,8 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
  let opensearchUrl = getUrlPrefix(cfg) & "/opensearch"

  buildHtml(head):
-    link(rel="stylesheet", type="text/css", href="/css/style.css?v=19")
-    link(rel="stylesheet", type="text/css", href="/css/fontello.css?v=2")
+    link(rel="stylesheet", type="text/css", href="/css/style.css?v=22")
+    link(rel="stylesheet", type="text/css", href="/css/fontello.css?v=4")

    if theme.len > 0:
      link(rel="stylesheet", type="text/css", href=(&"/css/themes/{theme}.css"))
@@ -66,8 +66,8 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
    link(rel="search", type="application/opensearchdescription+xml", title=cfg.title,
                            href=opensearchUrl)

-    if canonical.len > 0:
-      link(rel="canonical", href=canonical)
+    if alternate.len > 0:
+      link(rel="alternate", href=alternate, title="View on X")

    if cfg.enableRss and rss.len > 0:
      link(rel="alternate", type="application/rss+xml", href=rss, title="RSS feed")
@@ -119,20 +119,20 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
    # this is last so images are also preloaded
    # if this is done earlier, Chrome only preloads one image for some reason
    link(rel="preload", type="font/woff2", `as`="font",
-         href="/fonts/fontello.woff2?21002321", crossorigin="anonymous")
+         href="/fonts/fontello.woff2?61663884", crossorigin="anonymous")

 proc renderMain*(body: VNode; req: Request; cfg: Config; prefs=defaultPrefs;
                 titleText=""; desc=""; ogTitle=""; rss=""; video="";
                 images: seq[string] = @[]; banner=""): string =

-  let canonical = getTwitterLink(req.path, req.params)
+  let twitterLink = getTwitterLink(req.path, req.params)

  let node = buildHtml(html(lang="en")):
    renderHead(prefs, cfg, req, titleText, desc, video, images, banner, ogTitle,
-               rss, canonical)
+               rss, twitterLink)

    body:
-      renderNavbar(cfg, req, rss, canonical)
+      renderNavbar(cfg, req, rss, twitterLink)

      tdiv(class="container"):
        body
--- a/src/views/renderutils.nim
+++ b/src/views/renderutils.nim
@@ -26,7 +26,9 @@ proc icon*(icon: string; text=""; title=""; class=""; href=""): VNode =
 template verifiedIcon*(user: User): untyped {.dirty.} =
  if user.verifiedType != VerifiedType.none:
    let lower = ($user.verifiedType).toLowerAscii()
-    icon "ok", class=(&"verified-icon {lower}"), title=(&"Verified {lower} account")
+    buildHtml(tdiv(class=(&"verified-icon {lower}"))):
+      icon "circle", class="verified-icon-circle", title=(&"Verified {lower} account")
+      icon "ok", class="verified-icon-check", title=(&"Verified {lower} account")
  else:
    text ""

@@ -89,6 +91,13 @@ proc genDate*(pref, state: string): VNode =
    input(name=pref, `type`="date", value=state)
    icon "calendar"

+proc genNumberInput*(pref, label, state, placeholder: string; class=""; autofocus=true; min="0"): VNode =
+  let p = placeholder
+  buildHtml(tdiv(class=("pref-group pref-input " & class))):
+    if label.len > 0:
+      label(`for`=pref): text label
+    input(name=pref, `type`="number", placeholder=p, value=state, autofocus=(autofocus and state.len == 0), min=min, step="1")
+
 proc genImg*(url: string; class=""): VNode =
  buildHtml():
    img(src=getPicUrl(url), class=class, alt="", loading="lazy")
--- a/src/views/rss.nimf
+++ b/src/views/rss.nimf
@@ -2,6 +2,9 @@
 ## SPDX-License-Identifier: AGPL-3.0-only
 #import strutils, xmltree, strformat, options, unicode
 #import ../types, ../utils, ../formatters, ../prefs
+## Snowflake ID cutoff for RSS GUID format transition
+## Corresponds to approximately December 14, 2025 UTC
+#const guidCutoff = 2000000000000000000'i64
 #
 #proc getTitle(tweet: Tweet; retweet: string): string =
 #if tweet.pinned: result = "Pinned: "
@@ -25,7 +28,7 @@
 #end proc
 #
 #proc getDescription(desc: string; cfg: Config): string =
-Twitter feed for: ${desc}. Generated by ${cfg.hostname}
+Twitter feed for: ${desc}. Generated by ${getUrlPrefix(cfg)}
 #end proc
 #
 #proc getTweetsWithPinned(profile: Profile): seq[Tweets] =
@@ -51,16 +54,15 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
 #let urlPrefix = getUrlPrefix(cfg)
 #let text = replaceUrls(tweet.text, defaultPrefs, absolute=urlPrefix)
 <p>${text.replace("\n", "<br>\n")}</p>
-#if tweet.quote.isSome and get(tweet.quote).available:
-#  let quoteLink = getLink(get(tweet.quote))
-<p><a href="${urlPrefix}${quoteLink}">${cfg.hostname}${quoteLink}</a></p>
-#end if
 #if tweet.photos.len > 0:
 #  for photo in tweet.photos:
 <img src="${urlPrefix}${getPicUrl(photo)}" style="max-width:250px;" />
 #  end for
 #elif tweet.video.isSome:
-<img src="${urlPrefix}${getPicUrl(get(tweet.video).thumb)}" style="max-width:250px;" />
+<a href="${urlPrefix}${tweet.getLink}">
+<br>Video<br>
+  <img src="${urlPrefix}${getPicUrl(get(tweet.video).thumb)}" style="max-width:250px;" />
+</a>
 #elif tweet.gif.isSome:
 #  let thumb = &"{urlPrefix}{getPicUrl(get(tweet.gif).thumb)}"
 #  let url = &"{urlPrefix}{getPicUrl(get(tweet.gif).url)}"
@@ -72,6 +74,20 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
 <img src="${urlPrefix}${getPicUrl(card.image)}" style="max-width:250px;" />
 #  end if
 #end if
+#if tweet.quote.isSome and get(tweet.quote).available:
+#  let quoteTweet = get(tweet.quote)
+#  let quoteLink = urlPrefix & getLink(quoteTweet)
+<hr/>
+<blockquote>
+<b>${quoteTweet.user.fullname} (@${quoteTweet.user.username})</b>
+<p>
+${renderRssTweet(quoteTweet, cfg)}
+</p>
+<footer>
+— <cite><a href="${quoteLink}">${quoteLink}</a>
+</footer>
+</blockquote>
+#end if
 #end proc
 #
 #proc renderRssTweets(tweets: seq[Tweets]; cfg: Config; userId=""): string =
@@ -88,12 +104,17 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
 #    if link in links: continue
 #    end if
 #    links.add link
+#    let useGlobalGuid = tweet.id >= guidCutoff
      <item>
        <title>${getTitle(tweet, retweet)}</title>
        <dc:creator>@${tweet.user.username}</dc:creator>
        <description><![CDATA[${renderRssTweet(tweet, cfg).strip(chars={'\n'})}]]></description>
        <pubDate>${getRfc822Time(tweet)}</pubDate>
+#if useGlobalGuid:
+        <guid isPermaLink="false">${tweet.id}</guid>
+#else:
        <guid>${urlPrefix & link}</guid>
+#end if
        <link>${urlPrefix & link}</link>
      </item>
 #  end for
--- a/src/views/search.nim
+++ b/src/views/search.nim
@@ -10,14 +10,12 @@ const toggles = {
  "media": "Media",
  "videos": "Videos",
  "news": "News",
-  "verified": "Verified",
  "native_video": "Native videos",
  "replies": "Replies",
  "links": "Links",
  "images": "Images",
-  "safe": "Safe",
  "quote": "Quotes",
-  "pro_video": "Pro videos"
+  "spaces": "Spaces"
 }.toOrderedTable

 proc renderSearch*(): VNode =
@@ -53,7 +51,7 @@ proc renderSearchTabs*(query: Query): VNode =

 proc isPanelOpen(q: Query): bool =
  q.fromUser.len == 0 and (q.filters.len > 0 or q.excludes.len > 0 or
-  @[q.near, q.until, q.since].anyIt(it.len > 0))
+  @[q.minLikes, q.until, q.since].anyIt(it.len > 0))

 proc renderSearchPanel*(query: Query): VNode =
  let user = query.fromUser.join(",")
@@ -85,8 +83,8 @@ proc renderSearchPanel*(query: Query): VNode =
            span(class="search-title"): text "-"
            genDate("until", query.until)
        tdiv:
-          span(class="search-title"): text "Near"
-          genInput("near", "", query.near, "Location...", autofocus=false)
+          span(class="search-title"): text "Minimum likes"
+          genNumberInput("min_faves", "", query.minLikes, "Number...", autofocus=false)

 proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
                        pinned=none(Tweet)): VNode =
--- a/src/views/status.nim
+++ b/src/views/status.nim
@@ -28,14 +28,19 @@ proc renderReplyThread(thread: Chain; prefs: Prefs; path: string): VNode =
    if thread.hasMore:
      renderMoreReplies(thread)

-proc renderReplies*(replies: Result[Chain]; prefs: Prefs; path: string): VNode =
+proc renderReplies*(replies: Result[Chain]; prefs: Prefs; path: string; tweet: Tweet = nil): VNode =
  buildHtml(tdiv(class="replies", id="r")):
+    var hasReplies = false
+    var replyCount = 0
    for thread in replies.content:
      if thread.content.len == 0: continue
+      hasReplies = true
+      replyCount += thread.content.len
      renderReplyThread(thread, prefs, path)

-    if replies.bottom.len > 0:
-      renderMore(Query(), replies.bottom, focus="#r")
+    if hasReplies and replies.bottom.len > 0:
+      if tweet == nil or not replies.beginning or replyCount < tweet.stats.replies:
+        renderMore(Query(), replies.bottom, focus="#r")

 proc renderConversation*(conv: Conversation; prefs: Prefs; path: string): VNode =
  let hasAfter = conv.after.content.len > 0
@@ -70,6 +75,6 @@ proc renderConversation*(conv: Conversation; prefs: Prefs; path: string): VNode
      if not conv.replies.beginning:
        renderNewer(Query(), getLink(conv.tweet), focus="#r")
      if conv.replies.content.len > 0 or conv.replies.bottom.len > 0:
-        renderReplies(conv.replies, prefs, path)
+        renderReplies(conv.replies, prefs, path, conv.tweet)

    renderToTop(focus="#m")
--- a/src/views/timeline.nim
+++ b/src/views/timeline.nim
@@ -56,7 +56,7 @@ proc renderThread(thread: Tweets; prefs: Prefs; path: string): VNode =
                  index=i, last=(i == thread.high), showThread=show)

 proc renderUser(user: User; prefs: Prefs): VNode =
-  buildHtml(tdiv(class="timeline-item")):
+  buildHtml(tdiv(class="timeline-item", data-username=user.username)):
    a(class="tweet-link", href=("/" & user.username))
    tdiv(class="tweet-body profile-result"):
      tdiv(class="tweet-header"):
--- a/src/views/tweet.nim
+++ b/src/views/tweet.nim
@@ -109,6 +109,7 @@ proc renderVideo*(video: Video; prefs: Prefs; path: string): VNode =
            video(poster=thumb, data-url=source, data-autoload="false", muted=prefs.muteVideos)
            verbatim "<div class=\"video-overlay\" onclick=\"playVideo(this)\">"
            tdiv(class="overlay-circle"): span(class="overlay-triangle")
+            tdiv(class="overlay-duration"): text getDuration(video)
            verbatim "</div>"
      if container.len > 0:
        tdiv(class="card-content"):
@@ -178,14 +179,12 @@ func formatStat(stat: int): string =
  if stat > 0: insertSep($stat, ',')
  else: ""

-proc renderStats(stats: TweetStats; views: string): VNode =
+proc renderStats(stats: TweetStats): VNode =
  buildHtml(tdiv(class="tweet-stats")):
    span(class="tweet-stat"): icon "comment", formatStat(stats.replies)
    span(class="tweet-stat"): icon "retweet", formatStat(stats.retweets)
-    span(class="tweet-stat"): icon "quote", formatStat(stats.quotes)
    span(class="tweet-stat"): icon "heart", formatStat(stats.likes)
-    if views.len > 0:
-      span(class="tweet-stat"): icon "play", insertSep(views, ',')
+    span(class="tweet-stat"): icon "views", formatStat(stats.views)

 proc renderReply(tweet: Tweet): VNode =
  buildHtml(tdiv(class="replying-to")):
@@ -274,7 +273,7 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
    divClass = "thread-last " & class

  if not tweet.available:
-    return buildHtml(tdiv(class=divClass & "unavailable timeline-item")):
+    return buildHtml(tdiv(class=divClass & "unavailable timeline-item", data-username=tweet.user.username)):
      tdiv(class="unavailable-box"):
        if tweet.tombstone.len > 0:
          text tweet.tombstone
@@ -296,12 +295,11 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
    tweet = tweet.retweet.get
    retweet = fullTweet.user.fullname

-  buildHtml(tdiv(class=("timeline-item " & divClass))):
+  buildHtml(tdiv(class=("timeline-item " & divClass), data-username=tweet.user.username)):
    if not mainTweet:
      a(class="tweet-link", href=getLink(tweet))

    tdiv(class="tweet-body"):
-      var views = ""
      renderHeader(tweet, retweet, pinned, prefs)

      if not afterTweet and index == 0 and tweet.reply.len > 0 and
@@ -325,10 +323,8 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
        renderAlbum(tweet)
      elif tweet.video.isSome:
        renderVideo(tweet.video.get(), prefs, path)
-        views = tweet.video.get().views
      elif tweet.gif.isSome:
        renderGif(tweet.gif.get(), prefs)
-        views = "GIF"

      if tweet.poll.isSome:
        renderPoll(tweet.poll.get())
@@ -343,7 +339,7 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
        renderMediaTags(tweet.mediaTags)

      if not prefs.hideTweetStats:
-        renderStats(tweet.stats, views)
+        renderStats(tweet.stats)

      if showThread:
        a(class="show-thread", href=("/i/status/" & $tweet.threadId)):
--- a/tests/test_card.py
+++ b/tests/test_card.py
@@ -11,12 +11,7 @@ card = [
    ['voidtarget/status/1094632512926605312',
     'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too)',
     'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too) - obsplugin.nim',
-     'gist.github.com', True],
-
-    ['nim_lang/status/1082989146040340480',
-     'Nim in 2018: A short recap',
-     'There were several big news in the Nim world in 2018 – two new major releases, partnership with Status, and much more. But let us go chronologically.',
-     'nim-lang.org', True]
+     'gist.github.com', True]
 ]

 no_thumb = [
--- a/tests/test_profile.py
+++ b/tests/test_profile.py
@@ -15,7 +15,19 @@ protected = [
    ['Poop', 'Randy', 'Social media fanatic.']
 ]

-invalid = [['thisprofiledoesntexist'], ['%']]
+invalid = [['thisprofiledoesntexist']]
+
+malformed = [
+    ['${userId}'],
+    ['$%7BuserId%7D'],  # URL encoded version
+    ['%'],  # Percent sign is invalid
+    ['user@name'],
+    ['user.name'],
+    ['user-name'],
+    ['user$name'],
+    ['user{name}'],
+    ['user name'],  # space
+]

 banner_image = [
    ['mobile_test', 'profile_banners%2F82135242%2F1384108037%2F1500x500']
@@ -65,6 +77,13 @@ class ProfileTest(BaseTestCase):
        self.open_nitter(username)
        self.assert_text(f'User "{username}" not found')

+    @parameterized.expand(malformed)
+    def test_malformed_username(self, username):
+        """Test that malformed usernames (with invalid characters) return 404"""
+        self.open_nitter(username)
+        # Malformed usernames should return 404 page not found, not try to fetch from Twitter
+        self.assert_text('Page not found')
+
    def test_suspended(self):
        self.open_nitter('suspendme')
        self.assert_text('User "suspendme" has been suspended')
--- a/tools/create_session_browser.py
+++ b/tools/create_session_browser.py
@@ -1,23 +1,20 @@
 #!/usr/bin/env python3
 """
-Authenticates with X.com/Twitter and extracts session cookies for use with Nitter.
-Handles 2FA, extracts user info, and outputs clean JSON for sessions.jsonl.
-
 Requirements:
  pip install -r tools/requirements.txt

 Usage:
-  python3 tools/get_web_session.py <username> <password> [totp_seed] [--append sessions.jsonl] [--headless]
+  python3 tools/create_session_browser.py <username> <password> [totp_seed] [--append sessions.jsonl] [--headless]

 Examples:
  # Output to terminal
-  python3 tools/get_web_session.py myusername mypassword TOTP_BASE32_SECRET
+  python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET

  # Append to sessions.jsonl
-  python3 tools/get_web_session.py myusername mypassword TOTP_SECRET --append sessions.jsonl
+  python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET --append sessions.jsonl

  # Headless mode (may increase detection risk)
-  python3 tools/get_web_session.py myusername mypassword TOTP_SECRET --headless
+  python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET --headless

 Output:
  {"kind": "cookie", "username": "...", "id": "...", "auth_token": "...", "ct0": "..."}
@@ -97,7 +94,7 @@ async def login_and_get_cookies(username, password, totp_seed=None, headless=Fal

 async def main():
    if len(sys.argv) < 3:
-        print('Usage: python3 twitter-auth.py username password [totp_seed] [--append sessions.jsonl] [--headless]')
+        print('Usage: python3 create_session_browser.py username password [totp_seed] [--append file.jsonl] [--headless]')
        sys.exit(1)

    username = sys.argv[1]
--- a/tools/create_session_curl.py
+++ b/tools/create_session_curl.py
@@ -0,0 +1,328 @@
+#!/usr/bin/env python3
+"""
+Requirements:
+  pip install curl_cffi pyotp
+
+Usage:
+  python3 tools/create_session_curl.py <username> <password> [totp_seed] [--append sessions.jsonl]
+
+Examples:
+  # Output to terminal
+  python3 tools/create_session_curl.py myusername mypassword TOTP_SECRET
+
+  # Append to sessions.jsonl
+  python3 tools/create_session_curl.py myusername mypassword TOTP_SECRET --append sessions.jsonl
+
+Output:
+  {"kind": "cookie", "username": "...", "id": "...", "auth_token": "...", "ct0": "..."}
+"""
+
+import sys
+import json
+import pyotp
+from curl_cffi import requests
+
+BEARER_TOKEN = "AAAAAAAAAAAAAAAAAAAAAFQODgEAAAAAVHTp76lzh3rFzcHbmHVvQxYYpTw%3DckAlMINMjmCwxUcaXbAN4XqJVdgMJaHqNOFgPMK0zN1qLqLQCF"
+BASE_URL = "https://api.x.com/1.1/onboarding/task.json"
+GUEST_ACTIVATE_URL = "https://api.x.com/1.1/guest/activate.json"
+
+# Subtask versions required by API
+SUBTASK_VERSIONS = {
+    "action_list": 2, "alert_dialog": 1, "app_download_cta": 1,
+    "check_logged_in_account": 2, "choice_selection": 3,
+    "contacts_live_sync_permission_prompt": 0, "cta": 7, "email_verification": 2,
+    "end_flow": 1, "enter_date": 1, "enter_email": 2, "enter_password": 5,
+    "enter_phone": 2, "enter_recaptcha": 1, "enter_text": 5, "generic_urt": 3,
+    "in_app_notification": 1, "interest_picker": 3, "js_instrumentation": 1,
+    "menu_dialog": 1, "notifications_permission_prompt": 2, "open_account": 2,
+    "open_home_timeline": 1, "open_link": 1, "phone_verification": 4,
+    "privacy_options": 1, "security_key": 3, "select_avatar": 4,
+    "select_banner": 2, "settings_list": 7, "show_code": 1, "sign_up": 2,
+    "sign_up_review": 4, "tweet_selection_urt": 1, "update_users": 1,
+    "upload_media": 1, "user_recommendations_list": 4,
+    "user_recommendations_urt": 1, "wait_spinner": 3, "web_modal": 1
+}
+
+
+def get_base_headers(guest_token=None):
+    """Build base headers for API requests."""
+    headers = {
+        "Authorization": f"Bearer {BEARER_TOKEN}",
+        "Content-Type": "application/json",
+        "Accept": "*/*",
+        "Accept-Language": "en-US",
+        "X-Twitter-Client-Language": "en-US",
+        "Origin": "https://x.com",
+        "Referer": "https://x.com/",
+    }
+    if guest_token:
+        headers["X-Guest-Token"] = guest_token
+    return headers
+
+
+def get_cookies_dict(session):
+    """Extract cookies from session."""
+    return session.cookies.get_dict() if hasattr(session.cookies, 'get_dict') else dict(session.cookies)
+
+
+def make_request(session, headers, flow_token, subtask_data, print_msg):
+    """Generic request handler for flow steps."""
+    print(f"[*] {print_msg}...", file=sys.stderr)
+
+    payload = {
+        "flow_token": flow_token,
+        "subtask_inputs": [subtask_data] if isinstance(subtask_data, dict) else subtask_data
+    }
+
+    response = session.post(BASE_URL, json=payload, headers=headers)
+    response.raise_for_status()
+
+    data = response.json()
+    new_flow_token = data.get('flow_token')
+    if not new_flow_token:
+        raise Exception(f"Failed to get flow token: {print_msg}")
+
+    return new_flow_token, data
+
+
+def get_guest_token(session):
+    """Get guest token for unauthenticated requests."""
+    print("[*] Getting guest token...", file=sys.stderr)
+    response = session.post(GUEST_ACTIVATE_URL, headers={"Authorization": f"Bearer {BEARER_TOKEN}"})
+    response.raise_for_status()
+
+    guest_token = response.json().get('guest_token')
+    if not guest_token:
+        raise Exception("Failed to obtain guest token")
+
+    print(f"[*] Got guest token: {guest_token}", file=sys.stderr)
+    return guest_token
+
+
+def init_flow(session, guest_token):
+    """Initialize the login flow."""
+    print("[*] Initializing login flow...", file=sys.stderr)
+
+    headers = get_base_headers(guest_token)
+    payload = {
+        "input_flow_data": {
+            "flow_context": {
+                "debug_overrides": {},
+                "start_location": {"location": "manual_link"}
+            },
+            "subtask_versions": SUBTASK_VERSIONS
+        }
+    }
+
+    response = session.post(f"{BASE_URL}?flow_name=login", json=payload, headers=headers)
+    response.raise_for_status()
+
+    flow_token = response.json().get('flow_token')
+    if not flow_token:
+        raise Exception("Failed to get initial flow token")
+
+    print("[*] Got initial flow token", file=sys.stderr)
+    return flow_token, headers
+
+
+def submit_username(session, flow_token, headers, guest_token, username):
+    """Submit username."""
+    headers = headers.copy()
+    headers["X-Guest-Token"] = guest_token
+
+    subtask = {
+        "subtask_id": "LoginEnterUserIdentifierSSO",
+        "settings_list": {
+            "setting_responses": [{
+                "key": "user_identifier",
+                "response_data": {"text_data": {"result": username}}
+            }],
+            "link": "next_link"
+        }
+    }
+
+    flow_token, data = make_request(session, headers, flow_token, subtask, "Submitting username")
+
+    # Check for denial (suspicious activity)
+    if data.get('subtasks') and 'cta' in data['subtasks'][0]:
+        error_msg = data['subtasks'][0]['cta'].get('primary_text', {}).get('text')
+        if error_msg:
+            raise Exception(f"Login denied: {error_msg}")
+
+    return flow_token
+
+
+def submit_password(session, flow_token, headers, guest_token, password):
+    """Submit password and detect if 2FA is needed."""
+    headers = headers.copy()
+    headers["X-Guest-Token"] = guest_token
+
+    subtask = {
+        "subtask_id": "LoginEnterPassword",
+        "enter_password": {"password": password, "link": "next_link"}
+    }
+
+    flow_token, data = make_request(session, headers, flow_token, subtask, "Submitting password")
+
+    needs_2fa = any(s.get('subtask_id') == 'LoginTwoFactorAuthChallenge' for s in data.get('subtasks', []))
+    if needs_2fa:
+        print("[*] 2FA required", file=sys.stderr)
+
+    return flow_token, needs_2fa
+
+
+def submit_2fa(session, flow_token, headers, guest_token, totp_seed):
+    """Submit 2FA code."""
+    if not totp_seed:
+        raise Exception("2FA required but no TOTP seed provided")
+
+    code = pyotp.TOTP(totp_seed).now()
+    print("[*] Generating 2FA code...", file=sys.stderr)
+
+    headers = headers.copy()
+    headers["X-Guest-Token"] = guest_token
+
+    subtask = {
+        "subtask_id": "LoginTwoFactorAuthChallenge",
+        "enter_text": {"text": code, "link": "next_link"}
+    }
+
+    flow_token, _ = make_request(session, headers, flow_token, subtask, "Submitting 2FA code")
+    return flow_token
+
+
+def submit_js_instrumentation(session, flow_token, headers, guest_token):
+    """Submit JS instrumentation response."""
+    headers = headers.copy()
+    headers["X-Guest-Token"] = guest_token
+
+    subtask = {
+        "subtask_id": "LoginJsInstrumentationSubtask",
+        "js_instrumentation": {
+            "response": '{"rf":{"a4fc506d24bb4843c48a1966940c2796bf4fb7617a2d515ad3297b7df6b459b6":121,"bff66e16f1d7ea28c04653dc32479cf416a9c8b67c80cb8ad533b2a44fee82a3":-1,"ac4008077a7e6ca03210159dbe2134dea72a616f03832178314bb9931645e4f7":-22,"c3a8a81a9b2706c6fec42c771da65a9597c537b8e4d9b39e8e58de9fe31ff239":-12},"s":"ZHYaDA9iXRxOl2J3AZ9cc23iJx-Fg5E82KIBA_fgeZFugZGYzRtf8Bl3EUeeYgsK30gLFD2jTQx9fAMsnYCw0j8ahEy4Pb5siM5zD6n7YgOeWmFFaXoTwaGY4H0o-jQnZi5yWZRAnFi4lVuCVouNz_xd2BO2sobCO7QuyOsOxQn2CWx7bjD8vPAzT5BS1mICqUWyjZDjLnRZJU6cSQG5YFIHEPBa8Kj-v1JFgkdAfAMIdVvP7C80HWoOqYivQR7IBuOAI4xCeLQEdxlGeT-JYStlP9dcU5St7jI6ExyMeQnRicOcxXLXsan8i5Joautk2M8dAJFByzBaG4wtrPhQ3QAAAZEi-_t7"}',
+            "link": "next_link"
+        }
+    }
+
+    flow_token, _ = make_request(session, headers, flow_token, subtask, "Submitting JS instrumentation")
+    return flow_token
+
+
+def complete_flow(session, flow_token, headers):
+    """Complete the login flow."""
+    cookies = get_cookies_dict(session)
+
+    headers = headers.copy()
+    headers["X-Twitter-Auth-Type"] = "OAuth2Session"
+    if cookies.get('ct0'):
+        headers["X-Csrf-Token"] = cookies['ct0']
+
+    subtask = {
+        "subtask_id": "AccountDuplicationCheck",
+        "check_logged_in_account": {"link": "AccountDuplicationCheck_false"}
+    }
+
+    make_request(session, headers, flow_token, subtask, "Completing login flow")
+
+
+def extract_user_id(cookies_dict):
+    """Extract user ID from twid cookie."""
+    twid = cookies_dict.get('twid', '').strip('"')
+
+    for prefix in ['u=', 'u%3D']:
+        if prefix in twid:
+            return twid.split(prefix)[1].split('&')[0].strip('"')
+
+    return None
+
+
+def login_and_get_cookies(username, password, totp_seed=None):
+    """Authenticate with X.com and extract session cookies."""
+    session = requests.Session(impersonate="chrome")
+
+    try:
+        guest_token = get_guest_token(session)
+        flow_token, headers = init_flow(session, guest_token)
+        flow_token = submit_js_instrumentation(session, flow_token, headers, guest_token)
+        flow_token = submit_username(session, flow_token, headers, guest_token, username)
+        flow_token, needs_2fa = submit_password(session, flow_token, headers, guest_token, password)
+
+        if needs_2fa:
+            flow_token = submit_2fa(session, flow_token, headers, guest_token, totp_seed)
+
+        complete_flow(session, flow_token, headers)
+
+        cookies_dict = get_cookies_dict(session)
+        cookies_dict['username'] = username
+
+        user_id = extract_user_id(cookies_dict)
+        if user_id:
+            cookies_dict['id'] = user_id
+
+        print("[*] Successfully authenticated", file=sys.stderr)
+        return cookies_dict
+
+    finally:
+        session.close()
+
+
+def main():
+    if len(sys.argv) < 3:
+        print('Usage: python3 create_session_curl.py username password [totp_seed] [--append sessions.jsonl]', file=sys.stderr)
+        sys.exit(1)
+
+    username = sys.argv[1]
+    password = sys.argv[2]
+    totp_seed = None
+    append_file = None
+
+    # Parse optional arguments
+    i = 3
+    while i < len(sys.argv):
+        arg = sys.argv[i]
+        if arg == '--append':
+            if i + 1 < len(sys.argv):
+                append_file = sys.argv[i + 1]
+                i += 2
+            else:
+                print('[!] Error: --append requires a filename', file=sys.stderr)
+                sys.exit(1)
+        elif not arg.startswith('--'):
+            if totp_seed is None:
+                totp_seed = arg
+            i += 1
+        else:
+            print(f'[!] Warning: Unknown argument: {arg}', file=sys.stderr)
+            i += 1
+
+    try:
+        cookies = login_and_get_cookies(username, password, totp_seed)
+
+        session = {
+            'kind': 'cookie',
+            'username': cookies['username'],
+            'id': cookies.get('id'),
+            'auth_token': cookies['auth_token'],
+            'ct0': cookies['ct0']
+        }
+
+        output = json.dumps(session)
+
+        if append_file:
+            with open(append_file, 'a') as f:
+                f.write(output + '\n')
+            print(f'✓ Session appended to {append_file}', file=sys.stderr)
+        else:
+            print(output)
+
+        sys.exit(0)
+
+    except Exception as error:
+        print(f'[!] Error: {error}', file=sys.stderr)
+        import traceback
+        traceback.print_exc(file=sys.stderr)
+        sys.exit(1)
+
+
+if __name__ == '__main__':
+    main()
--- a/tools/requirements.txt
+++ b/tools/requirements.txt
@@ -1,2 +1,3 @@
 nodriver>=0.48.0
 pyotp
+curl_cffi
Author	SHA1	Message	Date
Zed	51b54852dc	Add preliminary support for nitter-proxy	2025-12-06 05:15:01 +01:00
Zed	663f5a52e1	Improve headers	2025-12-06 05:00:34 +01:00
Zed	17fc2628f9	Minor fix	2025-11-30 18:07:27 +01:00
Zed	e741385828	Allow , in username to support multiple users Fixes #1329	2025-11-30 18:06:22 +01:00
Zed	693a189462	Add heuristics to detect when to show "Load more" Fixes #1328	2025-11-30 05:43:17 +01:00
Zed	7734d976f7	Add username validation Fixes #1317	2025-11-30 04:12:38 +01:00
Zed	a62ec9cbb4	Normalize headers	2025-11-30 03:58:43 +01:00
Zed	4b9aec6fde	Use graphTweet for cookie sessions for now	2025-11-30 02:57:34 +01:00
Zed	064ec88080	Transition to ID-only RSS GUIDs on Dec 14, 2025 Fixes #447	2025-11-30 02:56:19 +01:00
Zed	71e65c84d7	Round video duration properly	2025-11-29 04:34:04 +01:00
Zed	436a873e4b	Improve verified checkmark icon, css improvements	2025-11-29 04:33:49 +01:00
Zed	96ec75fc7f	Add video duration to overlay Fixes #498	2025-11-29 03:38:40 +01:00
Zed	7a08a9e132	Format css	2025-11-29 03:36:21 +01:00
Zed	31d210ca47	Add experimental x-client-transaction-id support (#1324 ) * Add experimental x-client-transaction-id support * Remove broken test	2025-11-29 01:13:08 +01:00
Zed	dae68b4f13	Ignore null errors, they're internal API errors	2025-11-29 01:05:57 +01:00
Zed	8516ebe2b7	Fix 'key not found in object: expanded_url' error Fixes #1318	2025-11-29 00:37:45 +01:00
Zed	b83227aaf5	Implement temp fix for cookie sessions Fixes #1319	2025-11-26 01:03:27 +01:00
Zed	404b06b5f3	Include "Video" and link for video tweets in RSS (#1315 ) Fixes #836	2025-11-25 01:03:45 +01:00
Zed	2b922c049a	Embed quote tweet in RSS (#1316 ) Fixes #132 Closes #820	2025-11-25 01:02:45 +01:00
Zed	78101df2cc	Style number input field	2025-11-24 23:04:25 +01:00
Zed	12bbddf204	Update search panel grid layout and animation	2025-11-24 23:04:25 +01:00
Zed	4979d07f2e	Add spaces filter, remove broken filters	2025-11-24 23:04:25 +01:00
Zed	f038b53fa2	Fix body font size to match x.com Fixes #711	2025-11-24 23:04:25 +01:00
Zed	4748311f8d	Fix intent/follow URL redirect Fixes #629	2025-11-24 23:04:25 +01:00
Zed	d47eb8f0eb	Fix double slashes in url replacements Fixes #520	2025-11-24 23:04:25 +01:00
Zed	1657eeb769	Fix canonical link causing redirects to Twitter Fixes #526	2025-11-24 23:04:25 +01:00
Zed	25df682094	Expose username as HTML attribute Fixes #551	2025-11-24 23:04:25 +01:00
Zed	53edbbc4e9	Fix broken tweet pagination ("Load more" button) Fixes #1277	2025-11-23 20:00:10 +01:00
Zed	5b4a3fe691	Redirect /i/status/id/history to /i/status/id Fixes #1231	2025-11-23 19:27:13 +01:00
Zed	f8a17fdaa5	Remove Nim 1.6.x support Fixes #1311	2025-11-23 17:28:11 +01:00
Zed	b0d9c1d51a	Update endpoints, fix parser, remove quotes stat	2025-11-22 21:29:36 +01:00
Zed	78d788b27f	Fix verified parsing for oauth endpoints	2025-11-19 07:33:32 +01:00
Zed	824a7e346a	Fix rss icon tag	2025-11-17 12:08:44 +01:00
Zed	e8de18317e	Fix broken pinned tweet parsing	2025-11-17 11:21:21 +01:00
Zed	6b655cddd8	Cleanup	2025-11-17 11:01:20 +01:00
Zed	886f2d2a45	Bump API versions, use more SessionAwareUrls	2025-11-17 11:00:38 +01:00
Zed	bb6eb81a20	Add support for tweet views	2025-11-17 10:59:50 +01:00
Zed	0bb0b7e78c	Support grok_share card Fixes #1306	2025-11-17 06:37:24 +01:00
Zed	a666c4867c	Include username in session logs if available Fixes #1310	2025-11-17 05:42:44 +01:00
Zed	778eb35ee3	Add curl-based cookie session script	2025-11-17 03:55:23 +01:00